(S,E)-2-{4-[2-Hydroxy-3-(phenylsulphanyl)propoxy]phenyl}-5-hydroxy-7-methoxy-2,3-dihydrochromen-4-one

ID: ALA5283252

Max Phase: Preclinical

Molecular Formula: C25H24O6S

Molecular Weight: 452.53

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)c2c(c1)O[C@H](c1ccc(OCC(O)CSc3ccccc3)cc1)CC2=O

Standard InChI:  InChI=1S/C25H24O6S/c1-29-19-11-21(27)25-22(28)13-23(31-24(25)12-19)16-7-9-18(10-8-16)30-14-17(26)15-32-20-5-3-2-4-6-20/h2-12,17,23,26-27H,13-15H2,1H3/t17?,23-/m0/s1

Standard InChI Key:  YGEGHDXDKLDKEG-VXLWULRPSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -2.4962   -2.2678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4962   -1.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7847   -1.0261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7865   -0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5013    0.2070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2139   -0.2037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2139   -1.0287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9239   -1.4404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9239   -2.2655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6401   -1.0324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6401   -0.2041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3546    0.2083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0692   -0.2041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9256    0.2081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0721    0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3545   -0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3571    0.2092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3555    1.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3591    1.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0718    1.0322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0700    1.4428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7845    1.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4990    1.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2136    1.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9280    1.4428    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.4990    2.2678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6425    1.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3572    1.4425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0692    1.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0692    0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3590   -0.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6425    0.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  6  5  1  0
  7  6  2  0
  7  2  1  0
  8  7  1  0
  8  9  1  0
 10  8  2  0
 11 10  1  0
 11 12  1  0
 12 13  1  0
 14 11  2  0
  6 14  1  0
  4 15  1  6
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 15  2  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 23 26  1  0
 25 27  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5283252

    ---

Associated Targets(non-human)

L5178Y (1809 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.53Molecular Weight (Monoisotopic): 452.1294AlogP: 4.64#Rotatable Bonds: 8
Polar Surface Area: 85.22Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.69CX Basic pKa: CX LogP: 4.67CX LogD: 4.65
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: 0.41

References

1. Ferreira RJ, Gajdács M, Kincses A, Spengler G, Dos Santos DJVA, Ferreira MU..  (2020)  Nitrogen-containing naringenin derivatives for reversing multidrug resistance in cancer.,  28  (23.0): [PMID:33038666] [10.1016/j.bmc.2020.115798]

Source