The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-2-((S)-2-amino-4-methylpentanamido)-2-((2S,4R,5R)-6-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-4,5-dihydroxytetrahydro-2H-pyran-2-yl)acetic acid ID: ALA5283364
Max Phase: Preclinical
Molecular Formula: C17H26N4O8
Molecular Weight: 414.42
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](N)C(=O)N[C@H](C(=O)O)[C@@H]1C[C@@H](O)[C@@H](O)[C@H](n2ccc(=O)[nH]c2=O)O1
Standard InChI: InChI=1S/C17H26N4O8/c1-7(2)5-8(18)14(25)20-12(16(26)27)10-6-9(22)13(24)15(29-10)21-4-3-11(23)19-17(21)28/h3-4,7-10,12-13,15,22,24H,5-6,18H2,1-2H3,(H,20,25)(H,26,27)(H,19,23,28)/t8-,9+,10-,12-,13+,15+/m0/s1
Standard InChI Key: ZZTILVFYKBCCCO-ZWPBKHOASA-N
Molfile:
RDKit 2D
30 31 0 0 0 0 0 0 0 0999 V2000
3.2154 -0.6185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2154 0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9298 0.6189 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9298 1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6443 1.8564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2153 1.8564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5008 1.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5008 0.6190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7864 0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7864 -0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5008 -1.0313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0717 -1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0717 -1.8564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3570 -0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3570 0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0717 0.6191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2263 -0.3768 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.3574 0.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3574 1.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3570 1.8564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0718 1.8564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0718 0.2064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7864 0.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7864 1.4440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5008 0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5008 -0.6185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2153 0.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9298 0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6443 0.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9298 -0.6185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
6 7 2 0
8 7 1 0
8 2 1 0
9 8 1 1
10 9 1 0
10 11 1 6
12 10 1 0
12 13 1 6
14 12 1 0
15 14 1 0
15 16 1 0
9 16 1 0
15 17 1 6
15 18 1 0
18 19 1 6
19 20 1 0
19 21 2 0
18 22 1 0
22 23 1 0
23 24 2 0
23 25 1 0
25 26 1 1
25 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.42Molecular Weight (Monoisotopic): 414.1751AlogP: -2.51#Rotatable Bonds: 7Polar Surface Area: 196.97Molecular Species: ACIDHBA: 9HBD: 6#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.65CX Basic pKa: 8.41CX LogP: -4.32CX LogD: -4.36Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.28Np Likeness Score: 0.87
References 1. Serpi M, Ferrari V, Pertusati F.. (2016) Nucleoside Derived Antibiotics to Fight Microbial Drug Resistance: New Utilities for an Established Class of Drugs?, 59 (23): [PMID:27607900 ] [10.1021/acs.jmedchem.6b00325 ]