The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((4-methoxyphenyl)(4-methylpiperazin-1-yl)methyl)-2-phenyl-1H-indol-1-ol ID: ALA5283368
Max Phase: Preclinical
Molecular Formula: C27H29N3O2
Molecular Weight: 427.55
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(c2c(-c3ccccc3)n(O)c3ccccc23)N2CCN(C)CC2)cc1
Standard InChI: InChI=1S/C27H29N3O2/c1-28-16-18-29(19-17-28)26(21-12-14-22(32-2)15-13-21)25-23-10-6-7-11-24(23)30(31)27(25)20-8-4-3-5-9-20/h3-15,26,31H,16-19H2,1-2H3
Standard InChI Key: BBAJRFXAJHAPJE-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
1.4973 1.5828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2118 1.9952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9237 1.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9237 0.7582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2136 0.3464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4973 0.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6898 0.5033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2172 1.1596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7112 1.8298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6079 1.1596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4763 -0.2937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0598 -0.8772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8570 -0.6637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4381 -1.2461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2246 -2.0434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4318 -2.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8453 -1.6777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8080 -2.6269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3207 -0.5073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5345 -1.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3294 -1.5165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9130 -0.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7020 -0.1394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9067 0.0786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0207 0.4450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8434 0.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2561 1.1606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8470 1.8725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0222 1.8773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7101 -1.1465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9237 -1.9435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4976 2.6269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 2 0
9 8 1 0
1 9 1 0
8 10 1 0
7 11 1 0
11 12 1 0
13 12 1 0
14 13 1 0
15 14 1 0
16 15 1 0
17 16 1 0
12 17 1 0
15 18 1 0
11 19 1 0
20 19 2 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
19 24 1 0
25 10 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
10 29 1 0
22 30 1 0
30 31 1 0
9 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.55Molecular Weight (Monoisotopic): 427.2260AlogP: 4.89#Rotatable Bonds: 5Polar Surface Area: 40.87Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.84CX Basic pKa: 7.99CX LogP: 4.38CX LogD: 3.69Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -0.58