2-(cyclopent-2-en-1-yl)-1-[6-(2-hydroxypropan-2-yl)pyridin-2-yl]-6-{[4-(4-methylpiperazin-1-yl)phenyl]amino}-1H,2H,3H-pyrazolo[3,4-d]pyrimidin-3-one

ID: ALA5283530

Max Phase: Preclinical

Molecular Formula: C29H34N8O2

Molecular Weight: 526.65

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CCN(c2ccc(Nc3ncc4c(=O)n(C5C=CCC5)n(-c5cccc(C(C)(C)O)n5)c4n3)cc2)CC1

Standard InChI:  InChI=1S/C29H34N8O2/c1-29(2,39)24-9-6-10-25(32-24)37-26-23(27(38)36(37)22-7-4-5-8-22)19-30-28(33-26)31-20-11-13-21(14-12-20)35-17-15-34(3)16-18-35/h4,6-7,9-14,19,22,39H,5,8,15-18H2,1-3H3,(H,30,31,33)

Standard InChI Key:  LZTPSBCGWGMOMP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
    3.8141    0.6571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9891    0.6571    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5042    1.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7591    2.1092    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7196    1.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7196    0.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0051   -0.1678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2906    0.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4238   -0.1678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1383    0.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1383    1.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8528    1.4821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5672    1.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2817    1.4821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9962    1.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7106    1.4821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7106    2.3071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4250    2.7197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9962    2.7197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2817    2.3071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5672    0.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8528   -0.1678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2906    1.0696    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0051    1.4821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5041   -0.0103    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7591   -0.7949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2069   -1.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4620   -2.1926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2690   -2.3641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8210   -1.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6280   -1.9225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5660   -0.9664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1802   -1.3092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8416   -2.7197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4250   -2.1361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2267    1.3717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0483    1.1863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1292    0.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3692    0.0527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  3  5  1  0
  6  5  1  0
  7  6  2  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
 10 11  1  0
 12 11  2  0
 13 12  1  0
 14 13  1  0
 14 15  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 19 17  1  0
 20 19  1  0
 14 20  1  0
 21 13  2  0
 22 21  1  0
 10 22  2  0
 23  8  2  0
  5 24  2  0
 23 24  1  0
 25  6  1  0
  2 25  1  0
 26 25  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 31 30  1  0
 32 30  1  0
 32 26  2  0
 31 33  1  0
 31 34  1  0
 31 35  1  0
 36  1  1  0
 36 37  2  0
 37 38  1  0
 39 38  1  0
  1 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5283530

    ---

Associated Targets(Human)

PLK1 Tchem Serine/threonine-protein kinase PLK1 (28605 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
WEE1 Tchem Serine/threonine-protein kinase WEE1 (1772 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 526.65Molecular Weight (Monoisotopic): 526.2805AlogP: 3.59#Rotatable Bonds: 6
Polar Surface Area: 104.34Molecular Species: NEUTRALHBA: 10HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.69CX Basic pKa: 7.96CX LogP: 3.51CX LogD: 2.84
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.37Np Likeness Score: -0.86

References

1. Guler S, DiPoto MC, Crespo A, Caldwell R, Doerfel B, Grossmann N, Ho K, Huck B, Jones CC, Lan R, Musil D, Potnick J, Schilke H, Sherer B, Simon S, Sirrenberg C, Zhang Z, Liu-Bujalski L..  (2023)  Selective Wee1 Inhibitors Led to Antitumor Activity In Vitro and Correlated with Myelosuppression.,  14  (5): [PMID:37197456] [10.1021/acsmedchemlett.2c00481]

Source