The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-Hydroxyethyl)-1-(6-iodohex-5-ynyl)-pyrrolidin-1-ium 4-Methylbenzenesulfonate ID: ALA5283547
Max Phase: Preclinical
Molecular Formula: C19H28INO4S
Molecular Weight: 322.21
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(S(=O)(=O)[O-])cc1.OCC[N+]1(CCCCC#CI)CCCC1
Standard InChI: InChI=1S/C12H21INO.C7H8O3S/c13-7-3-1-2-4-8-14(11-12-15)9-5-6-10-14;1-6-2-4-7(5-3-6)11(8,9)10/h15H,1-2,4-6,8-12H2;2-5H,1H3,(H,8,9,10)/q+1;/p-1
Standard InChI Key: YGMXLTJXCPKCCT-UHFFFAOYSA-M
Molfile:
RDKit 2D
26 26 0 0 0 0 0 0 0 0999 V2000
1.2963 1.3393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7913 0.6114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6358 0.9026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6358 1.7761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7913 2.0381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5393 0.9026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2178 1.3393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9749 0.9026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7319 1.3393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4891 0.9026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2461 0.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0032 0.0290 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
0.5393 1.7761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5393 2.6497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2178 3.0865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4628 -1.8490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4628 -2.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7478 -3.0865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0329 -2.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0329 -1.8490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7478 -1.4366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3179 -3.0865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1777 -1.4366 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.1780 -0.6111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5912 -2.1527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0032 -1.4366 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
1 5 1 0
1 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 3 0
11 12 1 0
1 13 1 0
13 14 1 0
14 15 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
16 21 2 0
19 22 1 0
16 23 1 0
23 24 1 0
23 25 2 0
23 26 2 0
M CHG 2 1 1 24 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 322.21Molecular Weight (Monoisotopic): 322.0662AlogP: 2.16#Rotatable Bonds: 6Polar Surface Area: 20.23Molecular Species: NEUTRALHBA: 1HBD: 1#RO5 Violations: ┄HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.97CX Basic pKa: ┄CX LogP: -2.29CX LogD: -2.29Aromatic Rings: ┄Heavy Atoms: 15QED Weighted: 0.34Np Likeness Score: 0.79
References 1. Švec P, Nový Z, Kučka J, Petřík M, Sedláček O, Kuchař M, Lišková B, Medvedíková M, Kolouchová K, Groborz O, Loukotová L, Konefał RŁ, Hajdúch M, Hrubý M.. (2020) Iodinated Choline Transport-Targeted Tracers., 63 (24): [PMID:33271015 ] [10.1021/acs.jmedchem.0c01710 ]