The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,4R)-1-((S)-2-(1-fluorocyclopropanecarboxamido)-3,3-dimethylbutanoyl)-4-hydroxy-N-((S)-3-(methylamino)-1-(4-(4-methylthiazol-5-yl)phenyl)-3-oxopropyl)pyrrolidine-2-carboxamide ID: ALA5283593
Max Phase: Preclinical
Molecular Formula: C29H38FN5O5S
Molecular Weight: 587.72
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNC(=O)C[C@H](NC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@@H](NC(=O)C1(F)CC1)C(C)(C)C)c1ccc(-c2scnc2C)cc1
Standard InChI: InChI=1S/C29H38FN5O5S/c1-16-23(41-15-32-16)18-8-6-17(7-9-18)20(13-22(37)31-5)33-25(38)21-12-19(36)14-35(21)26(39)24(28(2,3)4)34-27(40)29(30)10-11-29/h6-9,15,19-21,24,36H,10-14H2,1-5H3,(H,31,37)(H,33,38)(H,34,40)/t19-,20+,21+,24-/m1/s1
Standard InChI Key: PTPPMFQIIPBSRV-MDAIXWLXSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
22.6039 -17.3207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8081 -17.5373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3936 -18.1182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1067 -15.9414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1056 -16.7688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8203 -17.1816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5368 -16.7683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5340 -15.9378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8186 -15.5287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8161 -14.7037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5293 -14.2891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2450 -14.6995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9582 -14.2849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2475 -15.5245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7135 -14.6164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.2637 -14.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8491 -13.2883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0426 -13.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1822 -12.5337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8882 -15.4226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2775 -15.9772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6740 -15.6744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8487 -16.4806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.2847 -15.1199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0704 -15.3716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1100 -14.3136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8252 -18.0066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1577 -18.4914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4125 -19.2761 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2375 -19.2763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4925 -18.4917 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.3731 -18.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1004 -14.2933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0980 -13.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3822 -13.0580 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8111 -13.0537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3798 -12.2331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8664 -14.5290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6343 -16.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2452 -16.1779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1983 -18.0932 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 11 1 0
11 12 1 0
13 12 1 6
12 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 13 1 0
17 19 1 1
15 20 1 0
20 21 2 0
20 22 1 0
22 23 1 6
22 24 1 0
24 25 1 0
24 26 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 27 1 0
6 27 1 0
28 32 1 0
10 33 1 6
33 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
24 38 1 0
23 39 1 0
39 2 1 0
39 40 2 0
2 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 587.72Molecular Weight (Monoisotopic): 587.2578AlogP: 2.41#Rotatable Bonds: 9Polar Surface Area: 140.73Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.15CX Basic pKa: 2.65CX LogP: 0.63CX LogD: 0.63Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.36Np Likeness Score: -0.44
References 1. Han X, Wang C, Qin C, Xiang W, Fernandez-Salas E, Yang CY, Wang M, Zhao L, Xu T, Chinnaswamy K, Delproposto J, Stuckey J, Wang S.. (2019) Discovery of ARD-69 as a Highly Potent Proteolysis Targeting Chimera (PROTAC) Degrader of Androgen Receptor (AR) for the Treatment of Prostate Cancer., 62 (2): [PMID:30629437 ] [10.1021/acs.jmedchem.8b01631 ]