(2R,3R,4R,5R)-4-fluoro-2-(hydroxymethyl)-5-(5-((6-methoxypyridin-2-yl)ethynyl)-4-methyl-7H-pyrrolo[2,3-d]pyrimidin-7-yl)-4-methyltetrahydrofuran-3-ol

ID: ALA5283594

Max Phase: Preclinical

Molecular Formula: C21H21FN4O4

Molecular Weight: 412.42

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(C#Cc2cn([C@@H]3O[C@H](CO)[C@@H](O)[C@@]3(C)F)c3ncnc(C)c23)n1

Standard InChI:  InChI=1S/C21H21FN4O4/c1-12-17-13(7-8-14-5-4-6-16(25-14)29-3)9-26(19(17)24-11-23-12)20-21(2,22)18(28)15(10-27)30-20/h4-6,9,11,15,18,20,27-28H,10H2,1-3H3/t15-,18-,20-,21-/m1/s1

Standard InChI Key:  OZSQSWMMHRHFME-ZQYQINFJSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   -0.7670   -3.7081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4343   -3.2232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1795   -2.4385    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3545   -2.4385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0995   -3.2232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4848   -3.8077    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.6986   -3.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0580   -1.7239    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2774   -0.9706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3353   -0.4186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0496   -0.8310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8781   -1.6377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4938   -2.1918    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2761   -1.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4450   -1.1293    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8318   -0.5775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0453    0.2194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3353    0.4064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3353    1.2315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3353    2.0566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3790    2.4692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3782    3.2920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3363    3.7047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0483    3.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0530    2.4709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2314   -3.4367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4450   -4.2337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7670   -4.5332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7628    3.7081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7628    4.5332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  5  6  1  0
  5  7  1  1
  4  8  1  1
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 11 16  1  0
 16 17  1  0
 10 18  1  0
 18 19  3  0
 19 20  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 20 25  1  0
  2 26  1  1
 26 27  1  0
  1 28  1  6
 24 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5283594

    ---

Associated Targets(non-human)

Zika virus (1028 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.42Molecular Weight (Monoisotopic): 412.1547AlogP: 1.52#Rotatable Bonds: 3
Polar Surface Area: 102.52Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.58CX Basic pKa: 3.92CX LogP: 1.99CX LogD: 1.98
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.63Np Likeness Score: -0.05

References

1. Yao G, Yu J, Lin C, Zhu Y, Duan A, Li M, Yuan J, Zhang J..  (2022)  Design, synthesis, and biological evaluation of novel 2'-methyl-2'-fluoro-6-methyl-7-alkynyl-7-deazapurine nucleoside analogs as anti-Zika virus agents.,  234  [PMID:35306290] [10.1016/j.ejmech.2022.114275]

Source