The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl (S)-2-(5-((2-amino-6-methyl-4-oxo-3,4-dihydroquinazolin-5-yl)thio)thiophene-2-carboxamido)-2-phenylacetate ID: ALA5283610
Max Phase: Preclinical
Molecular Formula: C23H20N4O4S2
Molecular Weight: 480.57
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@@H](NC(=O)c1ccc(Sc2c(C)ccc3nc(N)[nH]c(=O)c23)s1)c1ccccc1
Standard InChI: InChI=1S/C23H20N4O4S2/c1-12-8-9-14-17(21(29)27-23(24)25-14)19(12)33-16-11-10-15(32-16)20(28)26-18(22(30)31-2)13-6-4-3-5-7-13/h3-11,18H,1-2H3,(H,26,28)(H3,24,25,27,29)/t18-/m0/s1
Standard InChI Key: NRKOGCWOLJIPJU-SFHVURJKSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-1.9490 -0.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1519 0.2822 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.5608 0.8577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7681 1.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5627 1.8802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1537 1.3047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7667 2.6833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1775 3.2595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3795 3.0394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1748 2.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3810 2.0089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1796 1.2118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7706 0.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5677 -0.1633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3803 4.0591 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1328 -0.7414 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.1328 -1.5831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8896 -1.8585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3983 -1.2038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4239 -2.0051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2958 -1.6022 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0047 -2.0242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7246 -1.6213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7246 -0.7963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4540 -0.3952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1537 -0.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1537 -1.6382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4365 -2.0450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0047 -2.8490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2653 -3.2347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2653 -4.0591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7156 -3.2787 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4239 -2.8300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
4 5 1 0
5 6 2 0
7 5 1 0
8 7 1 0
9 8 2 0
10 9 1 0
10 4 1 0
11 10 2 0
12 11 1 0
13 12 2 0
3 13 1 0
13 14 1 0
8 15 1 0
16 1 1 0
16 17 1 0
17 18 2 0
19 18 1 0
1 19 2 0
17 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
24 23 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
23 28 1 0
22 29 1 1
29 30 1 0
30 31 1 0
29 32 2 0
20 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.57Molecular Weight (Monoisotopic): 480.0926AlogP: 3.67#Rotatable Bonds: 6Polar Surface Area: 127.17Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.22CX Basic pKa: 1.84CX LogP: 3.91CX LogD: 3.91Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: -0.77
References 1. Alagarsamy V, Chitra K, Saravanan G, Solomon VR, Sulthana MT, Narendhar B.. (2018) An overview of quinazolines: Pharmacological significance and recent developments., 151 [PMID:29656203 ] [10.1016/j.ejmech.2018.03.076 ]