The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1,N1'-((5-(methylamino)-1,3-phenylene)bis(methylene))bis(N3-cyclohexylpropane-1,3-diamine) ID: ALA5283630
Max Phase: Preclinical
Molecular Formula: C27H49N5
Molecular Weight: 443.72
Associated Items:
Names and Identifiers Canonical SMILES: CNc1cc(CNCCCNC2CCCCC2)cc(CNCCCNC2CCCCC2)c1
Standard InChI: InChI=1S/C27H49N5/c1-28-27-19-23(21-29-14-8-16-31-25-10-4-2-5-11-25)18-24(20-27)22-30-15-9-17-32-26-12-6-3-7-13-26/h18-20,25-26,28-32H,2-17,21-22H2,1H3
Standard InChI Key: KIVIBJLRCRUXBC-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
-0.7132 0.4143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0013 0.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7132 0.4147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7132 -0.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -0.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7132 -0.4141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4278 -0.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1425 -0.4141 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8571 -0.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5717 -0.4141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2864 -0.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0010 -0.4141 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.7156 -0.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7156 -1.6518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4303 -2.0644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1449 -1.6518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1449 -0.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4303 -0.4141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4278 -0.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1424 -0.4104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 -0.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 -0.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2863 -0.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0010 -0.4104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7156 -0.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4302 -0.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1449 -0.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1449 -1.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4302 -2.0608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7156 -1.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0013 1.6518 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7132 2.0644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
14 13 1 0
15 14 1 0
16 15 1 0
17 16 1 0
18 17 1 0
13 18 1 0
4 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
26 25 1 0
27 26 1 0
28 27 1 0
29 28 1 0
30 29 1 0
25 30 1 0
2 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.72Molecular Weight (Monoisotopic): 443.3988AlogP: 4.53#Rotatable Bonds: 15Polar Surface Area: 60.15Molecular Species: BASEHBA: 5HBD: 5#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.89CX LogP: 3.55CX LogD: -3.15Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.26Np Likeness Score: -0.23
References 1. Fang X, Meng Q, Zhang H, Liang B, Zhu S, Wang J, Zhang C, Huang LS, Zhang X, Schooley RT, An J, Xu Y, Huang Z.. (2020) Design, synthesis, and biological characterization of a new class of symmetrical polyamine-based small molecule CXCR4 antagonists., 200 [PMID:32492596 ] [10.1016/j.ejmech.2020.112410 ]