6-((5-chloro-2-((2-isopropoxy-5-methyl-4-(piperidin-4-yl)phenyl)amino)pyrimidin-4-yl)amino)benzo[c][1,2]oxaborol-1(3H)-ol

ID: ALA5283671

Max Phase: Preclinical

Molecular Formula: C26H31BClN5O3

Molecular Weight: 507.83

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(Nc2ncc(Cl)c(Nc3ccc4c(c3)B(O)OC4)n2)c(OC(C)C)cc1C1CCNCC1

Standard InChI:  InChI=1S/C26H31BClN5O3/c1-15(2)36-24-12-20(17-6-8-29-9-7-17)16(3)10-23(24)32-26-30-13-22(28)25(33-26)31-19-5-4-18-14-35-27(34)21(18)11-19/h4-5,10-13,15,17,29,34H,6-9,14H2,1-3H3,(H2,30,31,32,33)

Standard InChI Key:  FHSQKPCVTHNWQA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    0.4367    0.2089    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1512    0.6212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8631    0.2093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8631   -0.6158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1531   -1.0276    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4367   -0.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5778    0.6219    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.1512    1.4463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8659    1.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2779   -1.0321    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9925   -0.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8661    2.6842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5790    3.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2938    2.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2954    1.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5836    1.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0936    2.9327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5633    2.2831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0749    1.6178    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
    4.2885    0.8208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7074   -1.0319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4194   -0.6199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4194    0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7091    0.6173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9925    0.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7074   -1.8571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9927   -2.2697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1341    0.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8487    0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5633    0.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5633    1.4432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8487    1.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1341    1.4432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9927   -3.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2780   -1.8571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7091    1.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  2  8  1  0
  8  9  1  0
  6 10  1  0
 10 11  1  0
 12  9  2  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
  9 16  1  0
 14 17  1  0
 17 18  1  0
 19 18  1  0
 15 19  1  0
 19 20  1  0
 21 11  2  0
 22 21  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 11 25  1  0
 21 26  1  0
 26 27  1  0
 23 28  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 32 31  1  0
 33 32  1  0
 28 33  1  0
 27 34  1  0
 27 35  1  0
 24 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5283671

    ---

Associated Targets(Human)

ALK Tclin ALK tyrosine kinase receptor (7132 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H2228 (1030 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 507.83Molecular Weight (Monoisotopic): 507.2208AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Ren J, Gao Y, Shi W, Xu S, Wang Q, Zhao D, Kong L, Song W, Wang X, Zhang Y, He X, Wang Y, Tong S, Lu P, Li Y, Xu H, Zhang Y..  (2022)  Design and synthesis of boron-containing ALK inhibitor with favorable in vivo efficacy.,  75  [PMID:36332597] [10.1016/j.bmc.2022.117071]

Source