1'-((4-methoxybenzylidene)amino)-5'-oxo-1',4a,5',9a-tetrahydro-10H-spiro[acridine-9,2'-pyrrole]-4'-carbonitrile

ID: ALA5283678

Max Phase: Preclinical

Molecular Formula: C25H20N4O2

Molecular Weight: 408.46

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(/C=N/N2C(=O)C(C#N)=CC23c2ccccc2NC2C=CC=CC23)cc1

Standard InChI:  InChI=1S/C25H20N4O2/c1-31-19-12-10-17(11-13-19)16-27-29-24(30)18(15-26)14-25(29)20-6-2-4-8-22(20)28-23-9-5-3-7-21(23)25/h2-14,16,20,22,28H,1H3/b27-16+

Standard InChI Key:  SJMYMAPZEMVGPL-JVWAILMASA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    3.7484   -0.7807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0338   -0.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3219   -0.7803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3219   -1.6055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0320   -2.0172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7484   -1.6092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6041   -2.0196    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8925   -1.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8943   -0.7819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6092   -0.3694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3202    0.0410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1357    0.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3383    0.9389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0078    0.1828    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2147   -0.0296    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3658    0.5509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1589    0.3384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7397    0.9188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5302    0.7062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7427   -0.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1662   -0.6659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3723   -0.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9277    1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7163    1.4390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2969    2.0196    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1861   -0.3715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5261   -0.7803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5297   -1.5972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1774   -2.0134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5358   -0.2995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7484   -1.0926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  3 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 14 13  1  0
 10 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
 13 23  2  0
 12 24  1  0
 24 25  3  0
  9 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
  8 29  1  0
 20 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5283678

    ---

Associated Targets(Human)

NCI-H460 (60772 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.46Molecular Weight (Monoisotopic): 408.1586AlogP: 3.75#Rotatable Bonds: 3
Polar Surface Area: 77.72Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.21CX LogP: 3.27CX LogD: 3.27
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.78Np Likeness Score: 0.11

References

1. Bora D, Kaushal A, Shankaraiah N..  (2021)  Anticancer potential of spirocompounds in medicinal chemistry: A pentennial expedition.,  215  [PMID:33601313] [10.1016/j.ejmech.2021.113263]

Source