The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1'-((4-methoxybenzylidene)amino)-5'-oxo-1',4a,5',9a-tetrahydro-10H-spiro[acridine-9,2'-pyrrole]-4'-carbonitrile ID: ALA5283678
Max Phase: Preclinical
Molecular Formula: C25H20N4O2
Molecular Weight: 408.46
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=N/N2C(=O)C(C#N)=CC23c2ccccc2NC2C=CC=CC23)cc1
Standard InChI: InChI=1S/C25H20N4O2/c1-31-19-12-10-17(11-13-19)16-27-29-24(30)18(15-26)14-25(29)20-6-2-4-8-22(20)28-23-9-5-3-7-21(23)25/h2-14,16,20,22,28H,1H3/b27-16+
Standard InChI Key: SJMYMAPZEMVGPL-JVWAILMASA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
3.7484 -0.7807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0338 -0.3684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3219 -0.7803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3219 -1.6055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0320 -2.0172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7484 -1.6092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6041 -2.0196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8925 -1.6029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8943 -0.7819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6092 -0.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3202 0.0410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1357 0.8584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3383 0.9389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0078 0.1828 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2147 -0.0296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3658 0.5509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1589 0.3384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7397 0.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5302 0.7062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7427 -0.0870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1662 -0.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3723 -0.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9277 1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7163 1.4390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2969 2.0196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1861 -0.3715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5261 -0.7803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5297 -1.5972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1774 -2.0134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5358 -0.2995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7484 -1.0926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
4 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
3 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
14 13 1 0
10 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
13 23 2 0
12 24 1 0
24 25 3 0
9 26 1 0
27 26 2 0
28 27 1 0
29 28 2 0
8 29 1 0
20 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 408.46Molecular Weight (Monoisotopic): 408.1586AlogP: 3.75#Rotatable Bonds: 3Polar Surface Area: 77.72Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.21CX LogP: 3.27CX LogD: 3.27Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.78Np Likeness Score: 0.11
References 1. Bora D, Kaushal A, Shankaraiah N.. (2021) Anticancer potential of spirocompounds in medicinal chemistry: A pentennial expedition., 215 [PMID:33601313 ] [10.1016/j.ejmech.2021.113263 ]