2-methoxy-N-(3-((6-(methylamino)pyrimidin-4-yl)oxy)phenyl)acetamide

ID: ALA5283692

Max Phase: Preclinical

Molecular Formula: C14H16N4O3

Molecular Weight: 288.31

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNc1cc(Oc2cccc(NC(=O)COC)c2)ncn1

Standard InChI:  InChI=1S/C14H16N4O3/c1-15-12-7-14(17-9-16-12)21-11-5-3-4-10(6-11)18-13(19)8-20-2/h3-7,9H,8H2,1-2H3,(H,18,19)(H,15,16,17)

Standard InChI Key:  FCNMORNDKMSXPI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 22  0  0  0  0  0  0  0  0999 V2000
    4.2856    0.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5613   -0.1396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8570    0.2901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1327   -0.1047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4285    0.3249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7042   -0.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6839   -0.8947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0403   -1.2895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7445   -0.8597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7243   -0.0349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4284    0.3948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1528   -0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8570    0.4298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5814    0.0349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2856    0.4648    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2653    1.2895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6016   -0.7898    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8974   -1.2196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1731   -0.8248    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.3598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1126   -0.9295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  3  1  0
  4  5  1  0
  6  5  1  0
  6  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
 12 11  1  0
 12 13  1  0
 13 14  2  0
 15 14  1  0
 16 15  1  0
 17 14  1  0
 17 18  2  0
 18 19  1  0
 19 12  2  0
 20 10  1  0
  6 20  2  0
  4 21  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5283692

    ---

Associated Targets(Human)

MAP2K7 Tchem Dual specificity mitogen-activated protein kinase kinase 7 (1145 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 288.31Molecular Weight (Monoisotopic): 288.1222AlogP: 1.90#Rotatable Bonds: 6
Polar Surface Area: 85.37Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.65CX Basic pKa: 4.78CX LogP: 1.28CX LogD: 1.27
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.84Np Likeness Score: -1.96

References

1. Kim DR, Orr MJ, Kwong AJ, Deibler KK, Munshi HH, Bridges CS, Chen TJ, Zhang X, Lacorazza HD, Scheidt KA..  (2023)  Rational Design of Highly Potent and Selective Covalent MAP2K7 Inhibitors.,  14  (5): [PMID:37197477] [10.1021/acsmedchemlett.3c00029]

Source