6,7-dichloro-3-hydroxy-1H,2H,3H,5H-imidazo[2,1-b]quinazolin-2-one

ID: ALA5283704

Max Phase: Preclinical

Molecular Formula: C10H7Cl2N3O2

Molecular Weight: 272.09

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1NC2=Nc3ccc(Cl)c(Cl)c3CN2C1O

Standard InChI:  InChI=1S/C10H7Cl2N3O2/c11-5-1-2-6-4(7(5)12)3-15-9(17)8(16)14-10(15)13-6/h1-2,9,17H,3H2,(H,13,14,16)

Standard InChI Key:  KAXTUTDKZVOONF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 17 19  0  0  0  0  0  0  0  0999 V2000
    0.7211    0.8187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7293   -0.0061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0193   -0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6866   -0.0142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6947    0.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0070    1.2250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3966    1.2127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0984    0.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0984   -0.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3966   -0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3966   -1.2250    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.5092   -0.2605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9895    0.4043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5092    1.0691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8020    0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7195   -1.0453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8020   -0.4124    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  4  5  1  0
  6  1  2  0
  5  6  1  0
  7  5  2  0
  8  7  1  0
  9  8  2  0
 10  4  2  0
 10  9  1  0
 11 10  1  0
 12  2  1  0
 13 12  1  0
 14  1  1  0
 13 14  1  0
 15 13  2  0
 12 16  1  0
  9 17  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5283704

    ---

Associated Targets(Human)

PDE3A Tclin Phosphodiesterase 3 (1749 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 272.09Molecular Weight (Monoisotopic): 270.9915AlogP: 1.24#Rotatable Bonds:
Polar Surface Area: 64.93Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.77CX Basic pKa: 1.88CX LogP: 1.66CX LogD: 1.66
Aromatic Rings: 1Heavy Atoms: 17QED Weighted: 0.75Np Likeness Score: -0.21

References

1. Meanwell NA..  (2023)  Anagrelide: A Clinically Effective cAMP Phosphodiesterase 3A Inhibitor with Molecular Glue Properties.,  14  (4): [PMID:37077378] [10.1021/acsmedchemlett.3c00092]

Source