2-phenyl-N-(1H-tetrazol-5-yl)quinoline-4-carboxamide

ID: ALA5283717

Max Phase: Preclinical

Molecular Formula: C17H12N6O

Molecular Weight: 316.32

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1nnn[nH]1)c1cc(-c2ccccc2)nc2ccccc12

Standard InChI:  InChI=1S/C17H12N6O/c24-16(19-17-20-22-23-21-17)13-10-15(11-6-2-1-3-7-11)18-14-9-5-4-8-12(13)14/h1-10H,(H2,19,20,21,22,23,24)

Standard InChI Key:  OGLPTKDFYXRGBE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
   -2.4881   -0.6559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4881   -1.4809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7747   -1.8872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0677   -1.4772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0677   -0.6555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7765   -0.2453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3580   -0.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3556   -0.6571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3556   -1.4746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3529   -1.8895    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0673   -1.8855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0673   -2.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7808   -3.1172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4881   -2.7070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4881   -1.8851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7790   -1.4748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3580    0.5753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0696    0.9861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3535    0.9861    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3535    1.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3579    2.2187    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1733    3.0367    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6246    3.1172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9554    2.3605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  5  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  4 10  1  0
 11  9  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 11  2  0
  7 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 21 20  1  0
 21 22  1  0
 22 23  2  0
 24 23  1  0
 20 24  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5283717

    ---

Associated Targets(Human)

ME3 Tbio NADP-dependent malic enzyme, mitochondrial (80 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ME2 Tbio NAD-dependent malic enzyme, mitochondrial (32 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ME1 Tchem NADP-dependent malic enzyme (42 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 316.32Molecular Weight (Monoisotopic): 316.1073AlogP: 2.67#Rotatable Bonds: 3
Polar Surface Area: 96.45Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 2.89CX Basic pKa: 0.99CX LogP: 3.11CX LogD: 1.58
Aromatic Rings: 4Heavy Atoms: 24QED Weighted: 0.61Np Likeness Score: -1.92

References

1. Sheth G, Shah SR, Sengupta P, Jarag T, Chimanwala S, Sairam KVVM, Jain V, Talwar R, Dhanave A, Raviya M, Menon S, Trivedi S, Chitturi TR..  (2023)  In the Quest for Potent and Selective Malic Enzyme 3 Inhibitors for the Treatment of Pancreatic Ductal Adenocarcinoma.,  14  (1.0): [PMID:36655126] [10.1021/acsmedchemlett.2c00369]

Source