1-(3-Cyano-5-oxo-5,7-dihydrofuro[3,4-b]pyridin-2-yl)-4-fluoro-N-((1-phenylethyl)sulfonyl)piperidine-4-carboxamide

ID: ALA5283741

Max Phase: Preclinical

Molecular Formula: C22H21FN4O5S

Molecular Weight: 472.50

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(c1ccccc1)S(=O)(=O)NC(=O)C1(F)CCN(c2nc3c(cc2C#N)C(=O)OC3)CC1

Standard InChI:  InChI=1S/C22H21FN4O5S/c1-14(15-5-3-2-4-6-15)33(30,31)26-21(29)22(23)7-9-27(10-8-22)19-16(12-24)11-17-18(25-19)13-32-20(17)28/h2-6,11,14H,7-10,13H2,1H3,(H,26,29)

Standard InChI Key:  XJKHNEYHYQRNKZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   31.9117  -11.9318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9159  -12.7490    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   32.6215  -12.3368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6901  -12.0433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8729  -12.0433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2815  -12.7510    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.4682  -11.2236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.7644  -10.8135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7675   -9.9952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0616   -9.5852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0593  -11.2200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3528  -10.8137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3518   -9.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5742   -9.7448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0946  -10.4066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.5758  -11.0671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3207   -8.9679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.4731   -9.5892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1821   -9.1829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.4646  -12.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1643  -12.4472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8789  -11.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1747  -10.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0987  -12.7510    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.0987  -11.3355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3245  -13.4587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1416  -13.4587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5464  -14.1653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3629  -14.1657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7723  -13.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3593  -12.7474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5442  -12.7505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9154  -14.1661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  5  4  1  0
  6  5  1  0
  8  9  2  0
  9 10  1  0
 10 13  2  0
 12 11  2  0
 11  8  1  0
  7  8  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  1  0
 14 17  2  0
 18 19  3  0
  9 18  1  0
  7 20  1  0
  7 23  1  0
 20 21  1  0
 21  5  1  0
  5 22  1  0
 22 23  1  0
  4 24  1  0
  4 25  2  0
 24  2  1  0
  2 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 26 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5283741

    ---

Associated Targets(Human)

Homo sapiens (32628 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.50Molecular Weight (Monoisotopic): 472.1217AlogP: 2.14#Rotatable Bonds: 5
Polar Surface Area: 129.46Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.54CX Basic pKa: 0.62CX LogP: 1.99CX LogD: 1.05
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.66Np Likeness Score: -0.72

References

1. Kong D, Xue T, Guo B, Cheng J, Liu S, Wei J, Lu Z, Liu H, Gong G, Lan T, Hu W, Hu W, Yang Y..  (2019)  Optimization of P2Y12 Antagonist Ethyl 6-(4-((Benzylsulfonyl)carbamoyl)piperidin-1-yl)-5-cyano-2-methylnicotinate (AZD1283) Led to the Discovery of an Oral Antiplatelet Agent with Improved Druglike Properties.,  62  (6.0): [PMID:30843696] [10.1021/acs.jmedchem.8b01971]

Source