4-(5-methyl-2-(3-((2-(methylamino)ethylamino)methyl)phenyl)-6-(tetrahydro-2H-pyran-4-ylamino)pyrimidin-4-yl)phenol

ID: ALA5283756

Max Phase: Preclinical

Molecular Formula: C26H33N5O2

Molecular Weight: 447.58

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNCCNCc1cccc(-c2nc(NC3CCOCC3)c(C)c(-c3ccc(O)cc3)n2)c1

Standard InChI:  InChI=1S/C26H33N5O2/c1-18-24(20-6-8-23(32)9-7-20)30-26(31-25(18)29-22-10-14-33-15-11-22)21-5-3-4-19(16-21)17-28-13-12-27-2/h3-9,16,22,27-28,32H,10-15,17H2,1-2H3,(H,29,30,31)

Standard InChI Key:  MWZVFZHTXBYVNL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    6.0285  -27.2768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0273  -28.0964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7354  -28.5053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4450  -28.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4422  -27.2732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7336  -26.8680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3207  -26.8684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6130  -27.2772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1484  -26.8620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8549  -27.2709    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.5605  -26.8603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5579  -26.0422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8437  -25.6365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1409  -26.0494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2635  -25.6300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8377  -24.8193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1271  -24.4159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1236  -23.5969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4170  -23.1936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7099  -23.6038    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7139  -24.4220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4251  -24.8298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2671  -27.2644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2685  -28.0827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9767  -28.4889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6840  -28.0780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6787  -27.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9699  -26.8541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9052  -26.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1976  -27.2775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4898  -26.8691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7822  -27.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3936  -28.4833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  1  0
  5  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 12 15  1  0
 13 16  1  0
 16 17  1  0
 17 18  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 11 23  1  0
  8 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 26 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5283756

    ---

Associated Targets(Human)

CARM1 Tchem Histone-arginine methyltransferase CARM1 (564 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BT-549 (31254 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A-375 (9258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.58Molecular Weight (Monoisotopic): 447.2634AlogP: 3.72#Rotatable Bonds: 9
Polar Surface Area: 91.33Molecular Species: BASEHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.87CX Basic pKa: 9.26CX LogP: 3.16CX LogD: 1.69
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -0.56

References

1. Zhang Z, Guo Z, Xu X, Cao D, Yang H, Li Y, Shi Q, Du Z, Guo X, Wang X, Chen D, Zhang Y, Chen L, Zhou K, Li J, Geng M, Huang X, Xiong B..  (2021)  Structure-Based Discovery of Potent CARM1 Inhibitors for Solid Tumor and Cancer Immunology Therapy.,  64  (22.0): [PMID:34781683] [10.1021/acs.jmedchem.1c01308]

Source