The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(8-methoxy-2-methyl-1,2,3,4-tetrahydro-5H-pyrido[4,3-b]indol-5-yl)-3-(10H-phenothiazin-10-yl)propan-2-ol ID: ALA5283768
Max Phase: Preclinical
Molecular Formula: C28H29N3O2S
Molecular Weight: 471.63
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)c1c(n2CC(O)CN2c3ccccc3Sc3ccccc32)CCN(C)C1
Standard InChI: InChI=1S/C28H29N3O2S/c1-29-14-13-24-22(18-29)21-15-20(33-2)11-12-23(21)30(24)16-19(32)17-31-25-7-3-5-9-27(25)34-28-10-6-4-8-26(28)31/h3-12,15,19,32H,13-14,16-18H2,1-2H3
Standard InChI Key: OAUGZOJLSYFOGA-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
-0.7748 -0.2539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5984 -0.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0499 0.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6748 1.1288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8529 1.1711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4032 0.4785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3942 0.6921 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4376 1.5166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3332 1.8127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4613 2.6259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1804 3.1457 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9480 2.8527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0819 2.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0078 0.1395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8361 -0.6680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4497 -1.2206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0506 -0.9232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2779 -2.0284 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8915 -2.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7198 -3.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9344 -3.6436 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.3207 -3.0911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4926 -2.2835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6746 -2.3271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2885 -2.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1193 -3.6836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3361 -3.9433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4622 -3.3449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0759 -2.7924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9069 -1.9884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1237 -1.7287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8756 0.3934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2885 -0.3216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0333 3.9433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
8 7 1 0
9 8 2 0
5 9 1 0
9 10 1 0
11 10 1 0
12 11 1 0
13 12 1 0
8 13 1 0
7 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
16 18 1 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 1 0
23 22 2 0
18 23 1 0
19 24 1 0
25 24 2 0
26 25 1 0
27 26 2 0
20 27 1 0
22 28 1 0
29 28 2 0
30 29 1 0
31 30 2 0
23 31 1 0
3 32 1 0
32 33 1 0
11 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.63Molecular Weight (Monoisotopic): 471.1980AlogP: 5.30#Rotatable Bonds: 5Polar Surface Area: 40.87Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.79CX LogP: 4.86CX LogD: 4.77Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: -0.75