1-(8-methoxy-2-methyl-1,2,3,4-tetrahydro-5H-pyrido[4,3-b]indol-5-yl)-3-(10H-phenothiazin-10-yl)propan-2-ol

ID: ALA5283768

Max Phase: Preclinical

Molecular Formula: C28H29N3O2S

Molecular Weight: 471.63

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2c(c1)c1c(n2CC(O)CN2c3ccccc3Sc3ccccc32)CCN(C)C1

Standard InChI:  InChI=1S/C28H29N3O2S/c1-29-14-13-24-22(18-29)21-15-20(33-2)11-12-23(21)30(24)16-19(32)17-31-25-7-3-5-9-27(25)34-28-10-6-4-8-26(28)31/h3-12,15,19,32H,13-14,16-18H2,1-2H3

Standard InChI Key:  OAUGZOJLSYFOGA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
   -0.7748   -0.2539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5984   -0.3018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0499    0.3934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6748    1.1288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8529    1.1711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4032    0.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3942    0.6921    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4376    1.5166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3332    1.8127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4613    2.6259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1804    3.1457    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9480    2.8527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0819    2.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0078    0.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8361   -0.6680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4497   -1.2206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0506   -0.9232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2779   -2.0284    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8915   -2.5809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7198   -3.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9344   -3.6436    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.3207   -3.0911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4926   -2.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6746   -2.3271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2885   -2.8796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1193   -3.6836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3361   -3.9433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4622   -3.3449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0759   -2.7924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9069   -1.9884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1237   -1.7287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8756    0.3934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2885   -0.3216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0333    3.9433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  8  7  1  0
  9  8  2  0
  5  9  1  0
  9 10  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
  8 13  1  0
  7 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  0
 16 18  1  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  1  0
 23 22  2  0
 18 23  1  0
 19 24  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 20 27  1  0
 22 28  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 23 31  1  0
  3 32  1  0
 32 33  1  0
 11 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5283768

    ---

Associated Targets(Human)

BCHE Tclin Butyrylcholinesterase (7174 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 471.63Molecular Weight (Monoisotopic): 471.1980AlogP: 5.30#Rotatable Bonds: 5
Polar Surface Area: 40.87Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.79CX LogP: 4.86CX LogD: 4.77
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: -0.75

References

1. Dai J, Dan W, Zhang Y, Wang J..  (2018)  Recent developments on synthesis and biological activities of γ-carboline.,  157  [PMID:30103193] [10.1016/j.ejmech.2018.08.015]

Source