The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 5-((3-(4-Amino-5-oxo-5H-chromeno[4,3-d]pyrimidin-2-yl)phenoxy)sulfonyl)thiophene-2-carboxylate ID: ALA5283808
Max Phase: Preclinical
Molecular Formula: C23H15N3O7S2
Molecular Weight: 509.52
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc(S(=O)(=O)Oc2cccc(-c3nc(N)c4c(=O)oc5ccccc5c4n3)c2)s1
Standard InChI: InChI=1S/C23H15N3O7S2/c1-31-22(27)16-9-10-17(34-16)35(29,30)33-13-6-4-5-12(11-13)21-25-19-14-7-2-3-8-15(14)32-23(28)18(19)20(24)26-21/h2-11H,1H3,(H2,24,25,26)
Standard InChI Key: FGSGZKOGNLPETF-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
-3.4627 0.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7481 0.6192 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0362 0.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0362 -0.6177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7463 -1.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4627 -0.6213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1782 -1.0339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8960 -0.6198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8978 0.2044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1833 0.6227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1886 1.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9101 1.8591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6201 1.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6148 0.6132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1782 -1.8591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7463 -1.8547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3216 0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3213 1.4452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6084 1.8559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1063 1.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1079 0.6221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6038 0.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8225 0.2095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5371 0.6221 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.2518 0.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9504 1.3380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1254 1.3380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0053 0.5449 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.5572 -0.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1448 -0.7822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3380 -0.6106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3823 -0.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7950 0.6465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7950 -0.7825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6201 -0.7825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 3 1 0
5 4 2 0
6 5 1 0
1 6 2 0
6 7 1 0
8 7 1 0
9 8 1 0
10 9 2 0
1 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
9 14 1 0
7 15 2 0
5 16 1 0
17 3 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
21 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
24 27 2 0
28 25 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 25 2 0
29 32 1 0
32 33 2 0
32 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.52Molecular Weight (Monoisotopic): 509.0351AlogP: 3.60#Rotatable Bonds: 5Polar Surface Area: 151.68Molecular Species: NEUTRALHBA: 11HBD: 1#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.29CX LogP: 5.08CX LogD: 5.08Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.16Np Likeness Score: -1.00
References 1. Lv N, Sun M, Liu C, Li J.. (2017) Design and synthesis of 2-phenylpyrimidine coumarin derivatives as anticancer agents., 27 (19): [PMID:28888820 ] [10.1016/j.bmcl.2017.08.044 ]