methyl 5-((3-(4-Amino-5-oxo-5H-chromeno[4,3-d]pyrimidin-2-yl)phenoxy)sulfonyl)thiophene-2-carboxylate

ID: ALA5283808

Max Phase: Preclinical

Molecular Formula: C23H15N3O7S2

Molecular Weight: 509.52

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1ccc(S(=O)(=O)Oc2cccc(-c3nc(N)c4c(=O)oc5ccccc5c4n3)c2)s1

Standard InChI:  InChI=1S/C23H15N3O7S2/c1-31-22(27)16-9-10-17(34-16)35(29,30)33-13-6-4-5-12(11-13)21-25-19-14-7-2-3-8-15(14)32-23(28)18(19)20(24)26-21/h2-11H,1H3,(H2,24,25,26)

Standard InChI Key:  FGSGZKOGNLPETF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   -3.4627    0.2069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7481    0.6192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0362    0.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0362   -0.6177    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7463   -1.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4627   -0.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1782   -1.0339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8960   -0.6198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8978    0.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1833    0.6227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1886    1.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9101    1.8591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6201    1.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6148    0.6132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1782   -1.8591    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7463   -1.8547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3216    0.6199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3213    1.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6084    1.8559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1063    1.4432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1079    0.6221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6038    0.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8225    0.2095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5371    0.6221    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.2518    0.2095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9504    1.3380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1254    1.3380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0053    0.5449    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.5572   -0.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1448   -0.7822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3380   -0.6106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3823   -0.0679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7950    0.6465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7950   -0.7825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6201   -0.7825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  1  6  2  0
  6  7  1  0
  8  7  1  0
  9  8  1  0
 10  9  2  0
  1 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
  9 14  1  0
  7 15  2  0
  5 16  1  0
 17  3  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 24 27  2  0
 28 25  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 25  2  0
 29 32  1  0
 32 33  2  0
 32 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5283808

    ---

Associated Targets(Human)

CNE-2 (385 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KB (17409 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CAL-27 (814 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 509.52Molecular Weight (Monoisotopic): 509.0351AlogP: 3.60#Rotatable Bonds: 5
Polar Surface Area: 151.68Molecular Species: NEUTRALHBA: 11HBD: 1
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.29CX LogP: 5.08CX LogD: 5.08
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.16Np Likeness Score: -1.00

References

1. Lv N, Sun M, Liu C, Li J..  (2017)  Design and synthesis of 2-phenylpyrimidine coumarin derivatives as anticancer agents.,  27  (19): [PMID:28888820] [10.1016/j.bmcl.2017.08.044]

Source