The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-(2-chloro-4-nitrophenyl)hydrazono)-N-(3-chlorophenyl)-6-oxocyclohexa-1,4-dienecarboxamide ID: ALA5283839
Max Phase: Preclinical
Molecular Formula: C19H12Cl2N4O4
Molecular Weight: 431.24
Associated Items:
Names and Identifiers Canonical SMILES: O=C1C=C/C(=N\Nc2ccc([N+](=O)[O-])cc2Cl)C=C1C(=O)Nc1cccc(Cl)c1
Standard InChI: InChI=1S/C19H12Cl2N4O4/c20-11-2-1-3-12(8-11)22-19(27)15-9-13(4-7-18(15)26)23-24-17-6-5-14(25(28)29)10-16(17)21/h1-10,24H,(H,22,27)/b23-13+
Standard InChI Key: IRUCTMUVKDPOSM-YDZHTSKRSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
-4.6229 0.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6229 -0.6200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9095 -1.0264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2024 -0.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2024 0.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9113 0.6154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4908 0.6161 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7792 0.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0676 0.6161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0676 1.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3560 1.8486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3555 1.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3555 0.6161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3560 0.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0672 0.2053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7787 0.6161 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4904 0.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2021 0.6159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9112 0.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9112 -0.6162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2039 -1.0263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4904 -0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6228 -1.0270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3345 -0.6162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6228 -1.8487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2021 1.4376 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.7792 1.8487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7792 -0.6163 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3345 0.6157 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
5 7 1 0
7 8 1 0
8 9 1 0
10 9 1 0
11 10 1 0
12 11 2 0
13 12 1 0
14 13 1 0
9 14 2 0
13 15 2 0
15 16 1 0
16 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
23 20 1 0
23 24 2 0
23 25 1 0
18 26 1 0
10 27 2 0
8 28 2 0
1 29 1 0
M CHG 2 23 1 25 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.24Molecular Weight (Monoisotopic): 430.0236AlogP: 4.37#Rotatable Bonds: 5Polar Surface Area: 113.70Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.10CX Basic pKa: 3.53CX LogP: 5.31CX LogD: 5.31Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.32Np Likeness Score: -1.49