5-phenyl-2-((3,4,5-trimethylphenyl)amino)nicotinonitrile

ID: ALA5283977

Max Phase: Preclinical

Molecular Formula: C21H19N3

Molecular Weight: 313.40

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(Nc2ncc(-c3ccccc3)cc2C#N)cc(C)c1C

Standard InChI:  InChI=1S/C21H19N3/c1-14-9-20(10-15(2)16(14)3)24-21-18(12-22)11-19(13-23-21)17-7-5-4-6-8-17/h4-11,13H,1-3H3,(H,23,24)

Standard InChI Key:  UIGNHEWPTLMCLW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   -0.7105   -0.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7116   -1.4441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0011   -1.8559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7155   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7127   -0.6154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0006   -0.2075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4310   -1.8544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1441   -2.2646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4225   -1.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4236   -0.2015    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4205    0.6211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1333    1.0304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1305    1.8523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4159    2.2618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7026    1.8433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7089    1.0228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0128    2.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8416    2.2660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1312   -1.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8416   -1.8526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8415   -2.6746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1251   -3.0845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4175   -2.6718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4117    3.0845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  3  0
  2  9  1  0
  5 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 15 17  1  0
 13 18  1  0
  9 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23  9  1  0
 14 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5283977

    ---

Associated Targets(Human)

NFE2L2 Tchem Nuclear factor erythroid 2-related factor 2 (95332 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 313.40Molecular Weight (Monoisotopic): 313.1579AlogP: 5.29#Rotatable Bonds: 3
Polar Surface Area: 48.71Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.48CX LogP: 5.83CX LogD: 5.83
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.71Np Likeness Score: -1.29

References

1. Hou Z, Lockwood L, Zhang D, Occhiuto CJ, Mo L, Aldrich KE, Stoub HE, Gallo KA, Liby KT, Odom AL..  (2023)  Exploring structural effects in a new class of NRF2 inhibitors.,  14  (1.0): [PMID:36760735] [10.1039/d2md00211f]

Source