(R)-1-(5-chloropyrazin-2-yl)-3-(1-(2'-(dimethylphosphoryl)-2,3-difluoro-[1,1'-biphenyl]-4-yl)-4,4-dimethyl-2-oxopyrrolidin-3-yl)urea

ID: ALA5283999

Max Phase: Preclinical

Molecular Formula: C25H25ClF2N5O3P

Molecular Weight: 547.93

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1(C)CN(c2ccc(-c3ccccc3P(C)(C)=O)c(F)c2F)C(=O)[C@@H]1NC(=O)Nc1cnc(Cl)cn1

Standard InChI:  InChI=1S/C25H25ClF2N5O3P/c1-25(2)13-33(23(34)22(25)32-24(35)31-19-12-29-18(26)11-30-19)16-10-9-15(20(27)21(16)28)14-7-5-6-8-17(14)37(3,4)36/h5-12,22H,13H2,1-4H3,(H2,30,31,32,35)/t22-/m0/s1

Standard InChI Key:  OTLMDKSLNKNQJK-QFIPXVFZSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   -2.6026   -1.1953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8881   -0.7828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1736   -1.1953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4591   -0.7828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3729    0.0371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4335    0.2086    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8458   -0.5054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2940   -1.1182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8460    0.9230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4337    1.6377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8456    2.3496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6708    2.3496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0827    1.6395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6745    0.9230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9564    0.6205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8881    0.0421    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6026   -2.0203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8881   -2.4330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8889   -3.2555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6036   -3.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3153   -3.2591    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3200   -2.4346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0801   -1.9166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8768   -1.7023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0871    0.2086    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.9077    1.6395    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6036   -4.4932    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.0834    3.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6710    3.7787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0830    4.4907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9082    4.4907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3200    3.7805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9119    3.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8460    3.7787    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    0.4335    4.4932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1303    3.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8460    2.9530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  3  1  1
  5  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  4  1  0
  9  6  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
  9 14  1  0
  5 15  2  0
  2 16  2  0
  1 17  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
  8 23  1  0
  8 24  1  0
 14 25  1  0
 13 26  1  0
 20 27  1  0
 28 12  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 32 31  1  0
 28 33  1  0
 33 32  2  0
 29 34  1  0
 34 35  2  0
 34 36  1  0
 34 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5283999

    ---

Associated Targets(Human)

FPR2 Tchem Lipoxin A4 receptor (3472 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FPR1 Tchem Formyl peptide receptor 1 (1372 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 547.93Molecular Weight (Monoisotopic): 547.1352AlogP: 4.89#Rotatable Bonds: 5
Polar Surface Area: 104.29Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.11CX Basic pKa: CX LogP: 3.86CX LogD: 3.86
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.44Np Likeness Score: -0.63

References

1. Maciuszek M, Cacace A, Brennan E, Godson C, Chapman TM..  (2021)  Recent advances in the design and development of formyl peptide receptor 2 (FPR2/ALX) agonists as pro-resolving agents with diverse therapeutic potential.,  213  [PMID:33486199] [10.1016/j.ejmech.2021.113167]

Source