3-(4-chlorophenyl)-5-(4-fluorophenyl)-N-phenyl-4,5-dihydro-1H-pyrazole-1-carbothioamide

ID: ALA5284012

Max Phase: Preclinical

Molecular Formula: C22H17ClFN3S

Molecular Weight: 409.92

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Fc1ccc(C2CC(c3ccc(Cl)cc3)=NN2C(=S)Nc2ccccc2)cc1

Standard InChI:  InChI=1S/C22H17ClFN3S/c23-17-10-6-15(7-11-17)20-14-21(16-8-12-18(24)13-9-16)27(26-20)22(28)25-19-4-2-1-3-5-19/h1-13,21H,14H2,(H,25,28)

Standard InChI Key:  FXXDXVDOHUAMFC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   -1.3059    1.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4809    1.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2307    0.2601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8843   -0.2105    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5518    0.2813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5659    0.0466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1493    0.6297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9435    0.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1570   -0.3807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5778   -0.9621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7803   -0.7534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7183    1.7784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5432    1.7787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9536    2.4912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5411    3.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7204    3.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3041    2.4958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8843   -1.0354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1699   -1.4477    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5986   -1.4477    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.9536   -0.5941    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1699   -2.2725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5442   -2.6851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5434   -3.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1710   -3.9200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8825   -3.5111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8873   -2.6867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9535    3.9200    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  1  5  2  0
  5  4  1  0
  6  3  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
  6 11  1  0
 11 10  2  0
 12  1  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 12 17  1  0
 17 16  2  0
  4 18  1  0
 18 19  1  0
 18 20  2  0
  9 21  1  0
 19 22  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 22 27  1  0
 15 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5284012

    ---

Associated Targets(Human)

MAOA Tclin Monoamine oxidase A (11911 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MAOB Tclin Monoamine oxidase B (8835 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 409.92Molecular Weight (Monoisotopic): 409.0816AlogP: 6.03#Rotatable Bonds: 3
Polar Surface Area: 27.63Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.99CX Basic pKa: 1.02CX LogP: 6.44CX LogD: 6.44
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.54Np Likeness Score: -1.75

References

1. Nehra B, Rulhania S, Jaswal S, Kumar B, Singh G, Monga V..  (2020)  Recent advancements in the development of bioactive pyrazoline derivatives.,  205  [PMID:32795767] [10.1016/j.ejmech.2020.112666]

Source