The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,7-dihydroxy-8-(2-methylbutanoyl)-6-(3-methylbutyl)-4-phenyl-chroman-2-one ID: ALA5284038
Max Phase: Preclinical
Molecular Formula: C25H30O5
Molecular Weight: 410.51
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(C)C(=O)c1c(O)c(CCC(C)C)c(O)c2c1OC(=O)CC2c1ccccc1
Standard InChI: InChI=1S/C25H30O5/c1-5-15(4)22(27)21-24(29)17(12-11-14(2)3)23(28)20-18(13-19(26)30-25(20)21)16-9-7-6-8-10-16/h6-10,14-15,18,28-29H,5,11-13H2,1-4H3
Standard InChI Key: RPPPZDIIFHACRY-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
-0.3544 -0.4138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3544 0.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3571 0.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0659 0.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0659 -0.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3589 -0.8202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3589 -1.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0705 -2.0527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7821 -1.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0705 -2.8744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7821 -3.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3526 -2.0527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7776 -0.8210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4892 -0.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4892 0.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7776 0.8223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7776 1.6440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0661 2.0551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0668 2.8743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7786 3.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4875 2.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4923 2.0566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2008 -0.8211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3571 1.6433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0660 0.8219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7776 0.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4892 0.8219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2008 0.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4892 1.6436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0660 -0.8247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 3 1 0
5 4 2 0
6 5 1 0
1 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 1 0
10 11 1 0
7 12 2 0
5 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
4 16 1 0
16 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
14 23 2 0
3 24 1 0
2 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
1 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.51Molecular Weight (Monoisotopic): 410.2093AlogP: 5.36#Rotatable Bonds: 7Polar Surface Area: 83.83Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.59CX Basic pKa: ┄CX LogP: 6.73CX LogD: 6.51Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.36Np Likeness Score: 1.35
References 1. Gonçalves GA, Spillere AR, das Neves GM, Kagami LP, von Poser GL, Canto RFS, Eifler-Lima V.. (2020) Natural and synthetic coumarins as antileishmanial agents: A review., 203 [PMID:32668302 ] [10.1016/j.ejmech.2020.112514 ]