The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-1-(4-chlorophenyl)-3-(1-(2'-(dimethylphosphoryl)-2,3-difluoro-[1,1'-biphenyl]-4-yl)-2-oxopyrrolidin-3-yl)urea ID: ALA5284060
Max Phase: Preclinical
Molecular Formula: C25H23ClF2N3O3P
Molecular Weight: 517.90
Associated Items:
Names and Identifiers Canonical SMILES: CP(C)(=O)c1ccccc1-c1ccc(N2CC[C@@H](NC(=O)Nc3ccc(Cl)cc3)C2=O)c(F)c1F
Standard InChI: InChI=1S/C25H23ClF2N3O3P/c1-35(2,34)21-6-4-3-5-17(21)18-11-12-20(23(28)22(18)27)31-14-13-19(24(31)32)30-25(33)29-16-9-7-15(26)8-10-16/h3-12,19H,13-14H2,1-2H3,(H2,29,30,33)/t19-/m1/s1
Standard InChI Key: IBGZUUXZJGDMAS-LJQANCHMSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-2.6025 -1.1953 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8880 -0.7828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1736 -1.1953 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4591 -0.7828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3729 0.0371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4336 0.2086 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8459 -0.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2941 -1.1182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8461 0.9230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4337 1.6377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8456 2.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6709 2.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0827 1.6395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6746 0.9230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9563 0.6205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8880 0.0421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6025 -2.0203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8881 -2.4330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8889 -3.2555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6036 -3.6681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3153 -3.2591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3200 -2.4346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0871 0.2086 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.9077 1.6395 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.6036 -4.4932 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.0834 3.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6711 3.7787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0830 4.4907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9082 4.4907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3200 3.7805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9119 3.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8461 3.7787 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
0.4336 4.4932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1303 3.3654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8461 2.9530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
4 3 1 1
5 4 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
9 6 1 0
10 9 2 0
11 10 1 0
12 11 2 0
13 12 1 0
14 13 2 0
9 14 1 0
5 15 2 0
2 16 2 0
1 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
14 23 1 0
13 24 1 0
20 25 1 0
26 12 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
26 31 1 0
31 30 2 0
27 32 1 0
32 33 2 0
32 34 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 517.90Molecular Weight (Monoisotopic): 517.1134AlogP: 5.46#Rotatable Bonds: 5Polar Surface Area: 78.51Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.41CX Basic pKa: ┄CX LogP: 4.31CX LogD: 4.31Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.44Np Likeness Score: -1.18
References 1. Maciuszek M, Cacace A, Brennan E, Godson C, Chapman TM.. (2021) Recent advances in the design and development of formyl peptide receptor 2 (FPR2/ALX) agonists as pro-resolving agents with diverse therapeutic potential., 213 [PMID:33486199 ] [10.1016/j.ejmech.2021.113167 ]