(R)-1-(4-chlorophenyl)-3-(1-(2'-(dimethylphosphoryl)-2,3-difluoro-[1,1'-biphenyl]-4-yl)-2-oxopyrrolidin-3-yl)urea

ID: ALA5284060

Max Phase: Preclinical

Molecular Formula: C25H23ClF2N3O3P

Molecular Weight: 517.90

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CP(C)(=O)c1ccccc1-c1ccc(N2CC[C@@H](NC(=O)Nc3ccc(Cl)cc3)C2=O)c(F)c1F

Standard InChI:  InChI=1S/C25H23ClF2N3O3P/c1-35(2,34)21-6-4-3-5-17(21)18-11-12-20(23(28)22(18)27)31-14-13-19(24(31)32)30-25(33)29-16-9-7-15(26)8-10-16/h3-12,19H,13-14H2,1-2H3,(H2,29,30,33)/t19-/m1/s1

Standard InChI Key:  IBGZUUXZJGDMAS-LJQANCHMSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -2.6025   -1.1953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8880   -0.7828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1736   -1.1953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4591   -0.7828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3729    0.0371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4336    0.2086    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8459   -0.5054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2941   -1.1182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8461    0.9230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4337    1.6377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8456    2.3496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6709    2.3496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0827    1.6395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6746    0.9230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9563    0.6205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8880    0.0421    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6025   -2.0203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8881   -2.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8889   -3.2555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6036   -3.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3153   -3.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3200   -2.4346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0871    0.2086    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.9077    1.6395    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6036   -4.4932    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.0834    3.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6711    3.7787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0830    4.4907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9082    4.4907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3200    3.7805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9119    3.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8461    3.7787    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    0.4336    4.4932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1303    3.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8461    2.9530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  3  1  1
  5  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  4  1  0
  9  6  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
  9 14  1  0
  5 15  2  0
  2 16  2  0
  1 17  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
 14 23  1  0
 13 24  1  0
 20 25  1  0
 26 12  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 26 31  1  0
 31 30  2  0
 27 32  1  0
 32 33  2  0
 32 34  1  0
 32 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5284060

    ---

Associated Targets(Human)

FPR2 Tchem Lipoxin A4 receptor (3472 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FPR1 Tchem Formyl peptide receptor 1 (1372 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 517.90Molecular Weight (Monoisotopic): 517.1134AlogP: 5.46#Rotatable Bonds: 5
Polar Surface Area: 78.51Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.41CX Basic pKa: CX LogP: 4.31CX LogD: 4.31
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.44Np Likeness Score: -1.18

References

1. Maciuszek M, Cacace A, Brennan E, Godson C, Chapman TM..  (2021)  Recent advances in the design and development of formyl peptide receptor 2 (FPR2/ALX) agonists as pro-resolving agents with diverse therapeutic potential.,  213  [PMID:33486199] [10.1016/j.ejmech.2021.113167]

Source