The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5a,9a-dihydrospiro[benzo[b]fluorene-11,1'-isoindoline]-3',5,10-trione ID: ALA5284087
Max Phase: Preclinical
Molecular Formula: C24H15NO3
Molecular Weight: 365.39
Associated Items:
Names and Identifiers Canonical SMILES: O=C1NC2(C3=C(C(=O)C4C=CC=CC4C3=O)c3ccccc32)c2ccccc21
Standard InChI: InChI=1S/C24H15NO3/c26-21-13-7-1-2-8-14(13)22(27)20-19(21)15-9-3-5-11-17(15)24(20)18-12-6-4-10-16(18)23(28)25-24/h1-14H,(H,25,28)
Standard InChI Key: WKWGXQNWVSLESH-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 33 0 0 0 0 0 0 0 0999 V2000
-2.9572 1.1627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2426 1.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5308 1.1632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5308 0.3379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2409 -0.0737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9572 0.3342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7266 1.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2558 0.7597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7479 0.0921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0491 -0.1214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0491 -0.9629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6705 -1.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1879 -0.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9725 -2.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7927 -2.1425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3090 -1.4988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0114 -0.7253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7759 0.2975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5050 -0.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5068 -0.9603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7811 -1.3853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2272 0.2953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9535 -0.1215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9572 -0.9545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2360 -1.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5130 2.2104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7759 1.1226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7811 -2.2104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
7 8 1 0
9 8 1 0
4 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
13 12 2 0
9 13 1 0
12 14 1 0
15 14 2 0
16 15 1 0
17 16 2 0
13 17 1 0
10 18 1 0
19 18 1 0
20 19 1 0
21 20 1 0
11 21 1 0
19 22 1 0
23 22 2 0
24 23 1 0
25 24 2 0
20 25 1 0
7 26 2 0
18 27 2 0
21 28 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 365.39Molecular Weight (Monoisotopic): 365.1052AlogP: 2.95#Rotatable Bonds: ┄Polar Surface Area: 63.24Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.79CX Basic pKa: ┄CX LogP: 3.15CX LogD: 3.15Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.78Np Likeness Score: 0.42
References 1. Bora D, Kaushal A, Shankaraiah N.. (2021) Anticancer potential of spirocompounds in medicinal chemistry: A pentennial expedition., 215 [PMID:33601313 ] [10.1016/j.ejmech.2021.113263 ]