N-(4-bromophenyl)-2-(5-(4-methoxybenzyl)-3,4-dimethyl-6-oxopyridazin-1(6H)-yl)acetamide

ID: ALA5284145

Max Phase: Preclinical

Molecular Formula: C22H22BrN3O3

Molecular Weight: 456.34

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(Cc2c(C)c(C)nn(CC(=O)Nc3ccc(Br)cc3)c2=O)cc1

Standard InChI:  InChI=1S/C22H22BrN3O3/c1-14-15(2)25-26(13-21(27)24-18-8-6-17(23)7-9-18)22(28)20(14)12-16-4-10-19(29-3)11-5-16/h4-11H,12-13H2,1-3H3,(H,24,27)

Standard InChI Key:  LOYVDLUSJQJLKN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
    4.9995   -0.8246    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    4.2850   -0.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5749   -0.8239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8585   -0.4158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8585    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5731    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2850    0.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440    0.8251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4296    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4296   -0.4123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7151    0.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0006    0.4125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0006   -0.4126    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7139   -0.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7139   -1.6502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4285   -0.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4285    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1430    0.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8575    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5750    0.8268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2851    0.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2851   -0.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5704   -0.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8575   -0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9995   -0.8228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9995   -1.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7139    0.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7139    1.6502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1430   -0.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  2  7  2  0
  7  6  1  0
  8  5  1  0
  9  8  1  0
  9 10  2  0
 11  9  1  0
 12 11  1  0
 13 12  1  0
 14 13  2  0
 14 15  1  0
 16 14  1  0
 17 16  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 19  2  0
 22 25  1  0
 25 26  1  0
 12 27  1  0
 17 27  1  0
 27 28  2  0
 16 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5284145

    ---

Associated Targets(Human)

FPR2 Tchem Lipoxin A4 receptor (3472 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FPR1 Tchem Formyl peptide receptor 1 (1372 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.34Molecular Weight (Monoisotopic): 455.0845AlogP: 3.86#Rotatable Bonds: 6
Polar Surface Area: 73.22Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.69CX Basic pKa: CX LogP: 3.82CX LogD: 3.82
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.61Np Likeness Score: -1.48

References

1. Maciuszek M, Cacace A, Brennan E, Godson C, Chapman TM..  (2021)  Recent advances in the design and development of formyl peptide receptor 2 (FPR2/ALX) agonists as pro-resolving agents with diverse therapeutic potential.,  213  [PMID:33486199] [10.1016/j.ejmech.2021.113167]

Source