8,14-epoxyrabdoumbrosanin

ID: ALA5284209

Max Phase: Preclinical

Molecular Formula: C20H28O4

Molecular Weight: 332.44

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1C(=O)[C@]23O[C@@H]2[C@H]1CCC(=O)[C@]1(C)CCCC(C)(C)[C@H]1C[C@H]3O

Standard InChI:  InChI=1S/C20H28O4/c1-11-12-6-7-14(21)19(4)9-5-8-18(2,3)13(19)10-15(22)20(16(11)23)17(12)24-20/h12-13,15,17,22H,1,5-10H2,2-4H3/t12-,13+,15+,17+,19+,20-/m0/s1

Standard InChI Key:  FMJYLEICZDKMFF-JVCFTZKISA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   -0.9595    0.7653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9595   -0.0596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2452    0.3527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1853   -0.3615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2452    1.1777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4692    1.5902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9673    1.1869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9673    2.0113    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5912    0.6774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3881    0.8910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2887   -0.0596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7012   -0.7741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4690   -0.0596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0524    0.5237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2555    0.7372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2555    1.2785    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4690   -0.8844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1835   -1.2969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2452   -1.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9595   -0.8843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9595   -1.7094    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6738   -1.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2613   -2.0113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0863   -2.0113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3881   -0.8843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3881   -0.0596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6738    0.3527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6
  2  3  1  0
  3  4  2  0
  3  5  1  0
  5  6  1  0
  7  6  1  0
  7  8  1  6
  7  9  1  0
  9 10  2  0
 11  9  1  0
 11 12  2  0
 13 11  1  1
 13 14  1  0
 15 14  1  0
 15  7  1  0
 13 15  1  0
 15 16  1  6
 17 13  1  0
 17 18  1  6
 19 17  1  0
 20 19  1  0
 20  2  1  0
 20 21  1  1
 22 20  1  0
 22 23  1  0
 22 24  1  0
 25 22  1  0
 26 25  1  0
 26 27  1  0
  2 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5284209

    ---

Associated Targets(Human)

Panel NCI-60 (60 carcinoma cell lines) (1088 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

P388 (20296 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 332.44Molecular Weight (Monoisotopic): 332.1988AlogP: 2.83#Rotatable Bonds:
Polar Surface Area: 66.90Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.71CX Basic pKa: CX LogP: 3.49CX LogD: 3.49
Aromatic Rings: Heavy Atoms: 24QED Weighted: 0.55Np Likeness Score: 3.45

References

1. Asakawa Y, Ludwiczuk A..  (2018)  Chemical Constituents of Bryophytes: Structures and Biological Activity.,  81  (3): [PMID:29019405] [10.1021/acs.jnatprod.6b01046]

Source