6-(cyclopropanecarbonylamino)-4-[3-[(4-imidazol-1-ylphenyl)carbamoyl]-2-methoxy-anilino]-N-(trideuteriomethyl)pyridazine-3-carboxamide

ID: ALA5284232

Max Phase: Preclinical

Molecular Formula: C27H26N8O4

Molecular Weight: 526.56

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  [2H]C([2H])([2H])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(C(=O)Nc2ccc(-n3ccnc3)cc2)c1OC

Standard InChI:  InChI=1S/C27H26N8O4/c1-28-27(38)23-21(14-22(33-34-23)32-25(36)16-6-7-16)31-20-5-3-4-19(24(20)39-2)26(37)30-17-8-10-18(11-9-17)35-13-12-29-15-35/h3-5,8-16H,6-7H2,1-2H3,(H,28,38)(H,30,37)(H2,31,32,33,36)/i1D3

Standard InChI Key:  UHSWCNRANFORJC-FIBGUPNXSA-N

Molfile:  

 
     RDKit          2D

 42 46  0  0  0  0  0  0  0  0999 V2000
   -0.6631    1.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3752    1.8126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0921    1.4043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6631    0.5709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3897    0.1626    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3897   -0.6623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6824   -1.0790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6824   -1.9040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0295   -2.3206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7464   -1.9123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4584   -2.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2834   -2.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8667   -3.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7464   -1.0873    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3993   -2.3122    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1065   -1.8956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1065   -1.0706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8186   -0.6539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8186    0.1710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5355   -1.0623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2475   -0.6456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9596   -0.2290    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2475    0.1793    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9644   -1.0539    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0440    0.1543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7608    0.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7608    1.3876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0536    1.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0536    2.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7753    3.0376    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4873    2.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4873    1.7959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1945    1.3793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9162    1.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9162    2.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2042    3.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6535    3.0459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6309    1.3749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3456    1.7875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9644    1.2161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6336    0.4816    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8095    0.5739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 13 11  1  0
 13 12  1  0
 14 10  2  0
  8 15  1  0
 15 16  2  0
 17  6  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 21 24  1  0
  4 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28  1  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 36 31  2  0
 35 36  1  0
 29 37  2  0
 34 38  1  0
 39 38  1  0
 39 40  2  0
 40 41  1  0
 42 41  2  0
 38 42  1  0
M  ISO  3  22   2  23   2  24   2
M  END

Associated Targets(Human)

TYK2 Tclin Tyrosine-protein kinase TYK2 (5029 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 526.56Molecular Weight (Monoisotopic): 526.2077AlogP: 3.37#Rotatable Bonds: 9
Polar Surface Area: 152.16Molecular Species: NEUTRALHBA: 9HBD: 4
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.09CX Basic pKa: 6.05CX LogP: 3.29CX LogD: 3.27
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.26Np Likeness Score: -1.70

References

1. Liu F, Wang B, Liu Y, Shi W, Hu Z, Chang X, Tang X, Zhang Y, Xu H, He Y..  (2023)  Design, synthesis and biological evaluation of novel N-(methyl-d3) pyridazine-3-carboxamide derivatives as TYK2 inhibitors.,  86  [PMID:36907336] [10.1016/j.bmcl.2023.129235]

Source