5-((3-fluorophenethyl)amino)pyrimido[4,5-c]quinoline-8-carboxylic acid

ID: ALA5284276

Max Phase: Preclinical

Molecular Formula: C20H15FN4O2

Molecular Weight: 362.36

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)c1ccc2c(c1)nc(NCCc1cccc(F)c1)c1ncncc12

Standard InChI:  InChI=1S/C20H15FN4O2/c21-14-3-1-2-12(8-14)6-7-23-19-18-16(10-22-11-24-18)15-5-4-13(20(26)27)9-17(15)25-19/h1-5,8-11H,6-7H2,(H,23,25)(H,26,27)

Standard InChI Key:  BAABXZIJMLOGRY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   -1.0079    3.2899    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7328    2.8961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7520    2.0715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4806    1.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1877    2.1088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1649    2.9354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4399    3.3293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5046    0.8509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8023    0.4179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8263   -0.4067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1241   -0.8398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3930   -0.4425    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3168   -0.8851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2929   -1.7199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4409   -2.1187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1503   -1.6737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8751   -2.0676    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9057   -2.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2005   -3.3293    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4700   -2.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0001   -2.1556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7334   -1.7571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7594   -0.9263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0486   -0.4874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4843   -0.5323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5101    0.2895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1877   -0.9684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  2  0
  4  5  1  0
  6  5  2  0
  2  7  2  0
  7  6  1  0
  4  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
 14 15  1  0
 11 16  1  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 19 20  1  0
 20 15  2  0
 14 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 13 24  1  0
 23 25  1  0
 25 26  2  0
 25 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5284276

    ---

Associated Targets(Human)

CSNK2A1 Tchem Casein kinase II alpha (3512 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CSNK2A2 Tchem Casein kinase II alpha (prime) (1587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 362.36Molecular Weight (Monoisotopic): 362.1179AlogP: 3.67#Rotatable Bonds: 5
Polar Surface Area: 88.00Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.62CX Basic pKa: 1.59CX LogP: 3.46CX LogD: 0.13
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.53Np Likeness Score: -1.18

References

1. Davis-Gilbert ZW, Krämer A, Dunford JE, Howell S, Senbabaoglu F, Wells CI, Bashore FM, Havener TM, Smith JL, Hossain MA, Oppermann U, Drewry DH, Axtman AD..  (2023)  Discovery of a Potent and Selective Naphthyridine-Based Chemical Probe for Casein Kinase 2.,  14  (4): [PMID:37077385] [10.1021/acsmedchemlett.2c00530]

Source