(R)-N-(4'-(3-(3-(4-chlorophenyl)ureido)-2-oxopiperidin-1-yl)-[1,1'-biphenyl]-2-yl)methanesulfonamide

ID: ALA5284349

Max Phase: Preclinical

Molecular Formula: C25H25ClN4O4S

Molecular Weight: 513.02

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)Nc1ccccc1-c1ccc(N2CCC[C@@H](NC(=O)Nc3ccc(Cl)cc3)C2=O)cc1

Standard InChI:  InChI=1S/C25H25ClN4O4S/c1-35(33,34)29-22-6-3-2-5-21(22)17-8-14-20(15-9-17)30-16-4-7-23(24(30)31)28-25(32)27-19-12-10-18(26)11-13-19/h2-3,5-6,8-15,23,29H,4,7,16H2,1H3,(H2,27,28,32)/t23-/m1/s1

Standard InChI Key:  LOSIFPMBGPRRNJ-HSZRJFAPSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -4.9811   -0.8184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9811   -1.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2677   -2.0498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5606   -1.6397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5606   -0.8180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2695   -0.4078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8489   -0.4071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1372   -0.8180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4256   -0.4071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7139   -0.8180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0022   -0.4071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0022    0.4146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7093   -0.8180    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4210   -0.4071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4213    0.4147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1312    0.8237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8431    0.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8446   -0.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1358   -0.8197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7093   -1.6397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0022   -2.0506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7139   -1.6397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1372   -1.6397    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6928   -2.0543    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.5547    0.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5550    1.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2649    2.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9768    1.6433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9783    0.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2695    0.4109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2695   -0.4108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9812   -0.8216    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.6928   -0.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5695   -1.5347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3912   -1.5347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  1  1
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 15 14  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 14 19  1  0
 13 20  1  0
 21 20  1  0
 22 21  1  0
 10 22  1  0
  8 23  2  0
  2 24  1  0
 25 17  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 25 30  1  0
 30 29  2  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 32 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5284349

    ---

Associated Targets(Human)

FPR2 Tchem Lipoxin A4 receptor (3472 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FPR1 Tchem Formyl peptide receptor 1 (1372 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 513.02Molecular Weight (Monoisotopic): 512.1285AlogP: 4.70#Rotatable Bonds: 6
Polar Surface Area: 107.61Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.14CX Basic pKa: CX LogP: 3.12CX LogD: 3.11
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.44Np Likeness Score: -1.63

References

1. Maciuszek M, Cacace A, Brennan E, Godson C, Chapman TM..  (2021)  Recent advances in the design and development of formyl peptide receptor 2 (FPR2/ALX) agonists as pro-resolving agents with diverse therapeutic potential.,  213  [PMID:33486199] [10.1016/j.ejmech.2021.113167]

Source