The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-((2-(4-(2-(2-(4-nitrophenoxy)ethoxy)ethoxy)quinoline-8-sulfonamido)phenyl)ethynyl)picolinic acid ID: ALA5284412
Max Phase: Preclinical
Molecular Formula: C33H26N4O9S
Molecular Weight: 654.66
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1ccc(C#Cc2ccccc2NS(=O)(=O)c2cccc3c(OCCOCCOc4ccc([N+](=O)[O-])cc4)ccnc23)cn1
Standard InChI: InChI=1S/C33H26N4O9S/c38-33(39)29-15-9-23(22-35-29)8-10-24-4-1-2-6-28(24)36-47(42,43)31-7-3-5-27-30(16-17-34-32(27)31)46-21-19-44-18-20-45-26-13-11-25(12-14-26)37(40)41/h1-7,9,11-17,22,36H,18-21H2,(H,38,39)
Standard InChI Key: RHUORIODERFPNB-UHFFFAOYSA-N
Molfile:
RDKit 2D
47 51 0 0 0 0 0 0 0 0999 V2000
4.7362 -1.2704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9111 -1.2704 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.3237 -1.9848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4393 4.1579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4230 3.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1296 2.9054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8528 3.3065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5594 2.8808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1153 2.0823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8220 1.6566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5430 2.0540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2497 1.6283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9564 1.2026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6630 0.7769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6487 -0.0462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9256 -0.4472 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1986 -1.6829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1986 -2.5079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9111 -2.9204 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9111 -3.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1986 -4.1579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4821 -3.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7654 -4.1579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0529 -3.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3362 -4.1579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3762 -3.7454 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0887 -4.1579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8054 -3.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5220 -4.1579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2346 -3.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9470 -4.1579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6637 -3.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6637 -2.9204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3762 -2.5079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.0928 -2.9204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3762 -1.6829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9470 -2.5079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2346 -2.9204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4821 -2.9204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7654 -2.5079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7654 -1.6829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4821 -1.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3554 -0.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0764 -0.0744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0928 0.7522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3862 1.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2979 2.9337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
6 9 2 0
9 10 1 0
10 11 2 0
8 11 1 0
11 12 1 0
12 13 3 0
13 14 1 0
14 15 2 0
15 16 1 0
16 2 1 0
2 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 1 0
34 36 2 0
33 37 1 0
37 38 2 0
30 38 1 0
18 39 1 0
22 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
17 42 1 0
15 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
14 46 1 0
5 47 2 0
M CHG 2 34 1 35 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 654.66Molecular Weight (Monoisotopic): 654.1420AlogP: 4.91#Rotatable Bonds: 13Polar Surface Area: 180.08Molecular Species: ACIDHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.04CX Basic pKa: 1.89CX LogP: 4.94CX LogD: 1.06Aromatic Rings: 5Heavy Atoms: 47QED Weighted: 0.08Np Likeness Score: -1.28
References 1. Heinrich T, Sala-Hojman A, Ferretti R, Petersson C, Minguzzi S, Gondela A, Ramaswamy S, Bartosik A, Czauderna F, Crowley L, Wahra P, Schilke H, Böpple P, Dudek Ł, Leś M, Niedziejko P, Olech K, Pawlik H, Włoszczak Ł, Zuchowicz K, Suarez Alvarez JR, Martyka J, Sitek E, Mikulski M, Szczęśniak J, Jäckel S, Krier M, Król M, Wegener A, Gałęzowski M, Nowak M, Becker F, Herhaus C.. (2021) Discovery of 5-{2-[5-Chloro-2-(5-ethoxyquinoline-8-sulfonamido)phenyl]ethynyl}-4-methoxypyridine-2-carboxylic Acid, a Highly Selective in Vivo Useable Chemical Probe to Dissect MCT4 Biology., 64 (16.0): [PMID:34382802 ] [10.1021/acs.jmedchem.1c00448 ]