4,7-dihydroxy-6-methoxy-3-[(2-oxo-2H-chromen-7-yl)methyl]-2H-chromen-2-one

ID: ALA5284427

Max Phase: Preclinical

Molecular Formula: C20H14O7

Molecular Weight: 366.33

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2c(O)c(Cc3ccc4ccc(=O)oc4c3)c(=O)oc2cc1O

Standard InChI:  InChI=1S/C20H14O7/c1-25-17-8-12-16(9-14(17)21)27-20(24)13(19(12)23)6-10-2-3-11-4-5-18(22)26-15(11)7-10/h2-5,7-9,21,23H,6H2,1H3

Standard InChI Key:  HLWXAGMYSMDUKO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   -3.5701    0.8267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2837    1.2408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5719    0.0017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8583   -0.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1429   -0.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4293   -0.4155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7139   -0.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0003   -0.4187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7150   -0.0077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7168    0.8172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4323    1.2281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1458    0.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8612    1.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5749    0.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5730   -0.0140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2866   -0.4281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8576   -0.4250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440   -0.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4286   -0.4218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7121    0.8203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0033    1.2313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4257    1.2345    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1411    0.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8547    1.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2866   -0.4109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2866   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4293   -1.2408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 15 16  2  0
 17 15  1  0
 12 18  2  0
 18 17  1  0
 18 19  1  0
  9 19  2  0
  7 20  1  0
 20 21  2  0
 20 22  1  0
 23 22  1  0
  5 23  2  0
 23 24  1  0
 24  1  2  0
  3 25  1  0
 25 26  1  0
  6 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5284427

    ---

Associated Targets(Human)

POLB Tchem DNA polymerase beta (23632 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 366.33Molecular Weight (Monoisotopic): 366.0740AlogP: 2.91#Rotatable Bonds: 3
Polar Surface Area: 110.11Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 5.05CX Basic pKa: CX LogP: 2.35CX LogD: 0.09
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.54Np Likeness Score: 0.89

References

1. Faisal M, Saeed A, Shahzad D, Fattah TA, Lal B, Channar PA, Mahar J, Saeed S, Mahesar PA, Larik FA..  (2017)  Enzyme inhibitory activities an insight into the structure-Activity relationship of biscoumarin derivatives.,  141  [PMID:29032032] [10.1016/j.ejmech.2017.10.009]

Source