The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3E,3'E,4S,4'S,5S,5'S)-3,3'-(decane-1,10-diylidene)bis(4-hydroxy-5-methyldihydrofuran-2(3H)-one) ID: ALA5284432
Max Phase: Preclinical
Molecular Formula: C20H30O6
Molecular Weight: 366.45
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H]1OC(=O)/C(=C/CCCCCCCC/C=C2/C(=O)O[C@@H](C)[C@H]2O)[C@@H]1O
Standard InChI: InChI=1S/C20H30O6/c1-13-17(21)15(19(23)25-13)11-9-7-5-3-4-6-8-10-12-16-18(22)14(2)26-20(16)24/h11-14,17-18,21-22H,3-10H2,1-2H3/b15-11+,16-12+/t13-,14-,17+,18+/m0/s1
Standard InChI Key: KCJDQTLZAGPZQB-WBYKRSRGSA-N
Molfile:
RDKit 2D
26 27 0 0 0 0 0 0 0 0999 V2000
1.4632 2.8859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1327 2.4038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8650 1.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0615 1.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8205 2.4038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0438 2.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6062 0.9844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3470 0.9844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0256 0.2613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4809 -0.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8826 2.6448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1314 -1.1316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5832 -1.7961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2337 -2.5195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4049 -1.2140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6585 -0.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1093 -1.4733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4990 -2.1759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2951 -2.0100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8826 -2.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1578 -2.8859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3133 -1.3635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1630 -1.9954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9693 -1.9220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5055 -0.0897 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4324 -2.5786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
1 5 1 0
5 6 1 6
4 7 1 6
3 8 2 0
8 9 1 0
9 10 1 0
2 11 2 0
10 12 1 0
12 13 1 0
13 14 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
15 19 1 0
19 20 1 6
18 21 1 6
17 22 2 0
22 23 1 0
23 24 1 0
16 25 2 0
24 26 1 0
14 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 366.45Molecular Weight (Monoisotopic): 366.2042AlogP: 2.57#Rotatable Bonds: 9Polar Surface Area: 93.06Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.01CX Basic pKa: ┄CX LogP: 3.64CX LogD: 3.64Aromatic Rings: ┄Heavy Atoms: 26QED Weighted: 0.37Np Likeness Score: 1.29
References 1. Ahn S, Basavana Gowda MK, Lee M, Masagalli JN, Mailar K, Choi WJ, Noh M.. (2020) Novel linked butanolide dimer compounds increase adiponectin production during adipogenesis in human mesenchymal stem cells through peroxisome proliferator-activated receptor γ modulation., 187 [PMID:31865018 ] [10.1016/j.ejmech.2019.111969 ]