The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(7'-Peroxy-3',7'-dimethylocta-2',5'-dienyloxy)-6,8-dimethoxycoumarin ID: ALA5284439
Max Phase: Preclinical
Molecular Formula: C21H26O7
Molecular Weight: 390.43
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2ccc(=O)oc2c(OC)c1OC/C=C(\C)C/C=C/C(C)(C)OO
Standard InChI: InChI=1S/C21H26O7/c1-14(7-6-11-21(2,3)28-23)10-12-26-19-16(24-4)13-15-8-9-17(22)27-18(15)20(19)25-5/h6,8-11,13,23H,7,12H2,1-5H3/b11-6+,14-10+
Standard InChI Key: BZZXVPRMSSDNIO-PPGMXFKZSA-N
Molfile:
RDKit 2D
28 29 0 0 0 0 0 0 0 0999 V2000
1.4306 0.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1452 1.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8570 0.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8570 -0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1469 -0.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4306 -0.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 1.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2864 0.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2864 -0.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 -0.6191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0010 -0.6191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7159 -0.6228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0013 -0.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7131 -0.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4279 -0.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1425 -0.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4279 0.6149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8571 -0.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5718 -0.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2864 -0.2101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0010 -0.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2864 0.6149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7159 1.0309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7159 1.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1469 -1.4434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8617 -1.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0010 0.2024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.7154 -0.2101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 2 0
9 8 1 0
10 9 1 0
4 10 1 0
9 11 2 0
6 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
15 17 1 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
20 22 1 0
1 23 1 0
23 24 1 0
5 25 1 0
25 26 1 0
20 27 1 0
27 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 390.43Molecular Weight (Monoisotopic): 390.1679AlogP: 4.35#Rotatable Bonds: 9Polar Surface Area: 87.36Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.70CX Basic pKa: ┄CX LogP: 3.51CX LogD: 3.51Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.29Np Likeness Score: 2.20
References 1. Nhoek P, Ahn S, Pel P, Kim YM, Huh J, Kim HW, Noh M, Chin YW.. (2023) Alkaloids and Coumarins with Adiponectin-Secretion-Promoting Activities from the Leaves of Orixa japonica ., 86 (1.0): [PMID:36529937 ] [10.1021/acs.jnatprod.2c00844 ]