The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-{[1,1'-biphenyl]-4-yl}-1'-(4-chlorophenyl)-3'-(4-methoxyphenyl)-3,4-dihydro-1'H,2H-3,4'-bipyrazole ID: ALA5284447
Max Phase: Preclinical
Molecular Formula: C31H25ClN4O
Molecular Weight: 505.02
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2nn(-c3ccc(Cl)cc3)cc2C2CC(c3ccc(-c4ccccc4)cc3)=NN2)cc1
Standard InChI: InChI=1S/C31H25ClN4O/c1-37-27-17-11-24(12-18-27)31-28(20-36(35-31)26-15-13-25(32)14-16-26)30-19-29(33-34-30)23-9-7-22(8-10-23)21-5-3-2-4-6-21/h2-18,20,30,34H,19H2,1H3
Standard InChI Key: PPWSBDQPRBRJHV-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
-0.1896 0.4941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6353 0.4941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8855 -0.3097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2320 -0.7804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4354 -0.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6821 -0.5232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2652 0.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0104 -0.3315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8811 -1.1261 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0616 -1.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4643 -1.7093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2611 -1.4961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8419 -2.0781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6284 -2.8749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8362 -3.0889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2499 -2.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2116 -3.4581 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.2320 -0.5019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4457 -1.2985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2401 -1.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8235 -0.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6126 -0.1342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8177 0.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6201 -1.1407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8338 -1.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6283 -2.1494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2116 -1.5661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0007 -0.7730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2058 -0.5550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0518 0.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2552 1.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0431 1.8647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6264 2.4480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4195 2.2371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6375 1.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4130 3.2446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6163 3.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
1 5 2 0
5 4 1 0
3 6 1 0
7 6 1 0
7 8 2 0
8 9 1 0
10 9 1 0
6 10 2 0
11 9 1 0
12 11 2 0
13 12 1 0
14 13 2 0
15 14 1 0
11 16 1 0
16 15 2 0
14 17 1 0
18 5 1 0
19 18 2 0
20 19 1 0
21 20 2 0
22 21 1 0
18 23 1 0
23 22 2 0
24 21 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
24 29 1 0
29 28 2 0
30 7 1 0
31 30 2 0
32 31 1 0
33 32 2 0
34 33 1 0
30 35 1 0
35 34 2 0
33 36 1 0
36 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.02Molecular Weight (Monoisotopic): 504.1717AlogP: 7.31#Rotatable Bonds: 6Polar Surface Area: 51.44Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.33CX LogP: 7.41CX LogD: 7.41Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -1.16
References 1. Nehra B, Rulhania S, Jaswal S, Kumar B, Singh G, Monga V.. (2020) Recent advancements in the development of bioactive pyrazoline derivatives., 205 [PMID:32795767 ] [10.1016/j.ejmech.2020.112666 ]