5-{[1,1'-biphenyl]-4-yl}-1'-(4-chlorophenyl)-3'-(4-methoxyphenyl)-3,4-dihydro-1'H,2H-3,4'-bipyrazole

ID: ALA5284447

Max Phase: Preclinical

Molecular Formula: C31H25ClN4O

Molecular Weight: 505.02

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2nn(-c3ccc(Cl)cc3)cc2C2CC(c3ccc(-c4ccccc4)cc3)=NN2)cc1

Standard InChI:  InChI=1S/C31H25ClN4O/c1-37-27-17-11-24(12-18-27)31-28(20-36(35-31)26-15-13-25(32)14-16-26)30-19-29(33-34-30)23-9-7-22(8-10-23)21-5-3-2-4-6-21/h2-18,20,30,34H,19H2,1H3

Standard InChI Key:  PPWSBDQPRBRJHV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
   -0.1896    0.4941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6353    0.4941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.8855   -0.3097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2320   -0.7804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4354   -0.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6821   -0.5232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2652    0.0599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0104   -0.3315    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8811   -1.1261    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0616   -1.2503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4643   -1.7093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2611   -1.4961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8419   -2.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6284   -2.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8362   -3.0889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2499   -2.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2116   -3.4581    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.2320   -0.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4457   -1.2985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2401   -1.5106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8235   -0.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6126   -0.1342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8177    0.0836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6201   -1.1407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8338   -1.9374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6283   -2.1494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2116   -1.5661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0007   -0.7730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2058   -0.5550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0518    0.8565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2552    1.0702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0431    1.8647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6264    2.4480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4195    2.2371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6375    1.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4130    3.2446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6163    3.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  1  5  2  0
  5  4  1  0
  3  6  1  0
  7  6  1  0
  7  8  2  0
  8  9  1  0
 10  9  1  0
  6 10  2  0
 11  9  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 11 16  1  0
 16 15  2  0
 14 17  1  0
 18  5  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 22 21  1  0
 18 23  1  0
 23 22  2  0
 24 21  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 24 29  1  0
 29 28  2  0
 30  7  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 34 33  1  0
 30 35  1  0
 35 34  2  0
 33 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5284447

    ---

Associated Targets(non-human)

Mycolicibacterium smegmatis (8003 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Staphylococcus aureus (210822 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Candida albicans (78123 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 505.02Molecular Weight (Monoisotopic): 504.1717AlogP: 7.31#Rotatable Bonds: 6
Polar Surface Area: 51.44Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 3.33CX LogP: 7.41CX LogD: 7.41
Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: -1.16

References

1. Nehra B, Rulhania S, Jaswal S, Kumar B, Singh G, Monga V..  (2020)  Recent advancements in the development of bioactive pyrazoline derivatives.,  205  [PMID:32795767] [10.1016/j.ejmech.2020.112666]

Source