5,7-dimethoxy-8-(1-methoxy-2-methylbutyl)-6-(3-methylbut-2-en-1-yl)-4-phenyl-2H-chromen-2-one

ID: ALA5284492

Max Phase: Preclinical

Molecular Formula: C28H34O5

Molecular Weight: 450.58

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC(C)C(OC)c1c(OC)c(CC=C(C)C)c(OC)c2c(-c3ccccc3)cc(=O)oc12

Standard InChI:  InChI=1S/C28H34O5/c1-8-18(4)25(30-5)24-27(32-7)20(15-14-17(2)3)26(31-6)23-21(16-22(29)33-28(23)24)19-12-10-9-11-13-19/h9-14,16,18,25H,8,15H2,1-7H3

Standard InChI Key:  ZQCRORRTSHHAJZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   -0.3543   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3543    0.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3571    0.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0660    0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0660   -0.4101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3589   -0.8202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3589   -1.6419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0705   -2.0527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7821   -1.6419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0705   -2.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7821   -3.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3526   -2.0527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7776   -0.8210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4892   -0.4102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4892    0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7776    0.8223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7776    1.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0660    2.0551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0668    2.8743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7787    3.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4875    2.8779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4922    2.0566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2008   -0.8210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3571    1.6433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0660    0.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7776    0.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4892    0.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2008    0.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4892    1.6436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0660   -0.8246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3544    2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0660   -1.6463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3526   -2.8744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  1  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
  7 12  1  0
  5 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
  4 16  1  0
 16 17  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
 14 23  2  0
  3 24  1  0
  2 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 27 29  1  0
  1 30  1  0
 24 31  1  0
 30 32  1  0
 12 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5284492

    ---

Associated Targets(non-human)

Leishmania amazonensis (3813 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.58Molecular Weight (Monoisotopic): 450.2406AlogP: 6.72#Rotatable Bonds: 9
Polar Surface Area: 57.90Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.25CX LogD: 6.25
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.27Np Likeness Score: 1.11

References

1. Gonçalves GA, Spillere AR, das Neves GM, Kagami LP, von Poser GL, Canto RFS, Eifler-Lima V..  (2020)  Natural and synthetic coumarins as antileishmanial agents: A review.,  203  [PMID:32668302] [10.1016/j.ejmech.2020.112514]

Source