The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-Amino-4-((N-(((2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl)-5-chloropyrazine)-2-sulfonamido)butanoic acid ID: ALA5284517
Max Phase: Preclinical
Molecular Formula: C18H22ClN9O7S
Molecular Weight: 543.95
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncnc2c1ncn2[C@@H]1O[C@H](CN(CC[C@H](N)C(=O)O)S(=O)(=O)c2cnc(Cl)cn2)[C@@H](O)[C@H]1O
Standard InChI: InChI=1S/C18H22ClN9O7S/c19-10-3-23-11(4-22-10)36(33,34)27(2-1-8(20)18(31)32)5-9-13(29)14(30)17(35-9)28-7-26-12-15(21)24-6-25-16(12)28/h3-4,6-9,13-14,17,29-30H,1-2,5,20H2,(H,31,32)(H2,21,24,25)/t8-,9+,13+,14+,17+/m0/s1
Standard InChI Key: NUFHSMQFUWVWAB-ACSHICKMSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
0.5628 2.0876 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0968 1.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9193 1.5211 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4531 0.8924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3431 0.0749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9961 -0.4288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7591 -0.1154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8691 0.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6320 1.0153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2161 1.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1537 2.0284 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3523 2.2231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6638 0.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9773 -0.0059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1374 0.9516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7661 0.4177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1998 1.7741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9019 2.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6279 1.8156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3300 2.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0560 1.8571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7581 2.2900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7341 3.1145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.4840 1.8986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1860 2.3316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5081 1.0741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6519 0.9911 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.3779 0.5996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0799 1.0326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8060 0.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8300 -0.1832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1279 -0.6162 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4019 -0.2247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8549 1.2047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4384 0.1941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5445 -0.5958 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 1
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
10 8 1 0
4 10 2 0
11 10 1 0
12 11 2 0
12 3 1 0
2 13 1 0
13 14 1 6
13 15 1 0
15 16 1 6
17 15 1 0
1 17 1 0
17 18 1 1
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 1
22 24 1 0
24 25 1 0
24 26 2 0
19 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 28 2 0
27 34 2 0
27 35 2 0
31 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 543.95Molecular Weight (Monoisotopic): 543.1051AlogP: -2.04#Rotatable Bonds: 9Polar Surface Area: 245.79Molecular Species: ZWITTERIONHBA: 14HBD: 5#RO5 Violations: 2HBA (Lipinski): 16HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 2.00CX Basic pKa: 9.09CX LogP: -4.88CX LogD: -4.88Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.20Np Likeness Score: 0.13
References 1. Schwickert M, Zimmermann RA, Habeck T, Hoba SN, Nidoieva Z, Fischer TR, Stark MM, Kersten C, Lermyte F, Helm M, Schirmeister T.. (2023) Covalent S -Adenosylhomocysteine-Based DNA Methyltransferase 2 Inhibitors with a New Type of Aryl Warhead., 14 (6): [PMID:37312859 ] [10.1021/acsmedchemlett.3c00062 ]