The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-6-(3-ethyl-4-oxo-3,4-dihydroquinazolin-2-yl)-8-methyl-4-(2-methyl-1H-indol-3-yl)-4H-chromene-3-carbonitrile ID: ALA5284562
Max Phase: Preclinical
Molecular Formula: C30H25N5O2
Molecular Weight: 487.56
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCn1c(-c2cc(C)c3c(c2)C(c2c(C)[nH]c4ccccc24)C(C#N)=C(N)O3)nc2ccccc2c1=O
Standard InChI: InChI=1S/C30H25N5O2/c1-4-35-29(34-24-12-8-6-10-20(24)30(35)36)18-13-16(2)27-21(14-18)26(22(15-31)28(32)37-27)25-17(3)33-23-11-7-5-9-19(23)25/h5-14,26,33H,4,32H2,1-3H3
Standard InChI Key: OOBRGBKXVKKOCX-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
3.2270 -1.7703 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5110 -1.3603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7898 -1.7762 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0756 -1.3638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0736 -0.5331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7893 -0.1205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5091 -0.5295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2237 -0.1175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9384 0.2944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7847 0.7066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1107 1.1925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3645 1.9835 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1953 1.9867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4551 1.1977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2633 1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8152 1.6464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5557 2.4345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7445 2.6087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3271 0.9346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3565 -0.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3586 -0.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3576 -1.3654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3559 -1.7787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3594 -2.6087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0729 -0.1230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7926 -0.5391 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5054 -0.1211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5054 0.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7904 1.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0729 0.7065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7904 1.9450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2225 1.1190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9384 0.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9384 -0.1211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2225 -0.5401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3543 1.1214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3543 1.9513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 2 0
5 6 1 0
2 7 2 0
7 6 1 0
7 8 1 0
9 8 3 0
10 6 1 0
11 10 2 0
12 11 1 0
13 12 1 0
14 13 2 0
14 10 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
13 18 1 0
19 11 1 0
5 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
4 23 1 0
24 23 1 0
25 21 1 0
26 25 2 0
27 26 1 0
28 27 2 0
28 29 1 0
25 30 1 0
30 29 1 0
31 29 2 0
28 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
27 35 1 0
30 36 1 0
36 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.56Molecular Weight (Monoisotopic): 487.2008AlogP: 5.40#Rotatable Bonds: 3Polar Surface Area: 109.72Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.36CX LogP: 5.08CX LogD: 5.08Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.35Np Likeness Score: -0.91
References 1. Sardar A, Ansari A, Gupta S, Sinha S, Pandey S, Rai D, Kumar M, Bhatta RS, Trivedi R, Sashidhara KV.. (2022) Design, synthesis and biological evaluation of new quinazolinone-benzopyran-indole hybrid compounds promoting osteogenesis through BMP2 upregulation., 244 [PMID:36219902 ] [10.1016/j.ejmech.2022.114813 ]