4,7-dihydroxy-3-(4-hydroxyphenyl)-2H-chromen-2-one

ID: ALA5284565

Max Phase: Preclinical

Molecular Formula: C15H10O5

Molecular Weight: 270.24

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1oc2cc(O)ccc2c(O)c1-c1ccc(O)cc1

Standard InChI:  InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)13-14(18)11-6-5-10(17)7-12(11)20-15(13)19/h1-7,16-18H

Standard InChI Key:  KJOZVTXHSREPPH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
    0.3575   -1.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3575   -0.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3574    0.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0724   -0.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0724   -1.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3574   -1.4428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7900   -1.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5015   -1.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5015   -0.2068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7850    0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3574    1.0322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0727    0.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0725   -1.4428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0727    1.0334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7862    1.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5015    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5015    0.2096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7908   -0.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2167    1.4442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2167   -1.4406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  1  6  1  0
  5  6  1  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  4 10  1  0
  9 10  2  0
  3 11  1  0
  2 12  1  0
  1 13  2  0
 14 12  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 12 18  1  0
 16 19  1  0
  8 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5284565

    ---

Associated Targets(non-human)

pol Human immunodeficiency virus type 1 protease (9113 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 270.24Molecular Weight (Monoisotopic): 270.0528AlogP: 2.58#Rotatable Bonds: 1
Polar Surface Area: 90.90Molecular Species: ACIDHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 6.26CX Basic pKa: CX LogP: 2.09CX LogD: 0.71
Aromatic Rings: 3Heavy Atoms: 20QED Weighted: 0.59Np Likeness Score: 0.81

References

1. Hassan MZ, Osman H, Ali MA, Ahsan MJ..  (2016)  Therapeutic potential of coumarins as antiviral agents.,  123  [PMID:27484512] [10.1016/j.ejmech.2016.07.056]

Source