The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-((2-(2,4-dichlorophenoxy)-N-(4-phenylthiazol-2-yl)acetamido)methyl)phenyl)sulfamic acid ID: ALA5284575
Max Phase: Preclinical
Molecular Formula: C24H19Cl2N3O5S2
Molecular Weight: 564.47
Associated Items:
Names and Identifiers Canonical SMILES: O=C(COc1ccc(Cl)cc1Cl)N(Cc1ccc(NS(=O)(=O)O)cc1)c1nc(-c2ccccc2)cs1
Standard InChI: InChI=1S/C24H19Cl2N3O5S2/c25-18-8-11-22(20(26)12-18)34-14-23(30)29(13-16-6-9-19(10-7-16)28-36(31,32)33)24-27-21(15-35-24)17-4-2-1-3-5-17/h1-12,15,28H,13-14H2,(H,31,32,33)
Standard InChI Key: HCWQWUUSTYNJJY-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
0.7742 1.9302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0561 1.5241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6546 1.9429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3727 1.5368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3801 0.7119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0983 0.3057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8090 0.7246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5272 0.3185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2380 0.7373 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.2306 1.5624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8017 1.5496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0835 1.9557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0487 0.6991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7816 2.7552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0633 0.7373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.4516 -0.0597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4890 1.5175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2037 1.9302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9214 1.5158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7597 0.2801 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.5669 -0.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2352 -0.6134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5606 0.1494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6479 -1.3282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2354 -2.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6474 -2.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4730 -2.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8850 -2.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4767 -1.3282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6363 1.9282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3485 1.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3485 0.6907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6381 0.2787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9214 0.6869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6363 2.7535 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.0633 0.2780 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
7 6 1 0
7 8 1 0
9 8 1 0
9 10 1 0
7 11 2 0
11 12 1 0
12 4 2 0
13 2 1 0
1 14 2 0
9 15 2 0
9 16 2 0
1 17 1 0
18 17 1 0
18 19 1 0
20 13 1 0
20 21 1 0
21 22 2 0
23 22 1 0
13 23 2 0
22 24 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
30 19 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
19 34 1 0
30 35 1 0
32 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 564.47Molecular Weight (Monoisotopic): 563.0143AlogP: 5.94#Rotatable Bonds: 9Polar Surface Area: 108.83Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: -1.73CX Basic pKa: ┄CX LogP: 3.88CX LogD: 3.02Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.24Np Likeness Score: -1.86
References 1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S.. (2020) Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors., 28 (23.0): [PMID:32992253 ] [10.1016/j.bmc.2020.115777 ]