The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(3-((6-(3,4-dichloro-5-methyl-1H-pyrrole-2-carboxamido)-4,5,6,7-tetrahydrobenzo[d]thiazol-2-yl)amino)-3-oxopropyl)-5-hydroxy-4-oxo-1,4-dihydropyridine-2-carboxamide ID: ALA5284613
Max Phase: Preclinical
Molecular Formula: C22H22Cl2N6O5S
Molecular Weight: 553.43
Associated Items:
Names and Identifiers Canonical SMILES: Cc1[nH]c(C(=O)N[C@H]2CCc3nc(NC(=O)CCNC(=O)c4cc(=O)c(O)c[nH]4)sc3C2)c(Cl)c1Cl
Standard InChI: InChI=1S/C22H22Cl2N6O5S/c1-9-17(23)18(24)19(27-9)21(35)28-10-2-3-11-15(6-10)36-22(29-11)30-16(33)4-5-25-20(34)12-7-13(31)14(32)8-26-12/h7-8,10,27,32H,2-6H2,1H3,(H,25,34)(H,26,31)(H,28,35)(H,29,30,33)/t10-/m0/s1
Standard InChI Key: ZJOVVADZPGXOGF-JTQLQIEISA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
3.2192 -0.7844 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4223 -0.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8389 -0.4146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0421 -0.6281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8285 -1.4250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4587 -0.0448 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3381 -0.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6337 -0.9852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4575 -0.9852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0409 -1.5685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8377 -1.3550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0512 -0.5581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4679 0.0251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6710 -0.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9792 0.2608 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.8481 -0.3447 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0616 0.4521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4783 1.0355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8585 0.6657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5258 0.1809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5258 -0.6441 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-6.1931 0.6657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9900 0.4521 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-5.9383 1.4502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3507 2.1647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1134 1.4502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8025 -1.3678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5994 -1.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8130 -0.3574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6098 -0.1439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1931 -0.7273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9796 -1.5241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1828 -1.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5630 -2.1075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9900 -0.5138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5890 -2.1647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
4 5 2 0
6 4 1 0
7 6 1 0
7 8 2 0
9 8 1 0
10 9 1 0
11 10 1 0
12 11 1 0
13 12 1 0
14 13 1 0
9 14 2 0
14 15 1 0
15 7 1 0
12 16 1 6
17 16 1 0
17 18 2 0
19 17 1 0
19 20 2 0
20 21 1 0
20 22 1 0
22 23 1 0
22 24 2 0
24 25 1 0
24 26 1 0
26 19 1 0
1 27 1 0
27 28 1 0
29 28 1 0
30 29 1 0
31 30 2 0
32 31 1 0
33 32 1 0
28 33 2 0
32 34 2 0
31 35 1 0
27 36 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 553.43Molecular Weight (Monoisotopic): 552.0749AlogP: 2.53#Rotatable Bonds: 7Polar Surface Area: 169.07Molecular Species: NEUTRALHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 7.93CX Basic pKa: ┄CX LogP: 1.61CX LogD: 1.50Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.26Np Likeness Score: -1.35
References 1. He M, Fan M, Peng Z, Wang G.. (2021) An overview of hydroxypyranone and hydroxypyridinone as privileged scaffolds for novel drug discovery., 221 [PMID:34023737 ] [10.1016/j.ejmech.2021.113546 ]