(S)-N-(3-((6-(3,4-dichloro-5-methyl-1H-pyrrole-2-carboxamido)-4,5,6,7-tetrahydrobenzo[d]thiazol-2-yl)amino)-3-oxopropyl)-5-hydroxy-4-oxo-1,4-dihydropyridine-2-carboxamide

ID: ALA5284613

Max Phase: Preclinical

Molecular Formula: C22H22Cl2N6O5S

Molecular Weight: 553.43

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1[nH]c(C(=O)N[C@H]2CCc3nc(NC(=O)CCNC(=O)c4cc(=O)c(O)c[nH]4)sc3C2)c(Cl)c1Cl

Standard InChI:  InChI=1S/C22H22Cl2N6O5S/c1-9-17(23)18(24)19(27-9)21(35)28-10-2-3-11-15(6-10)36-22(29-11)30-16(33)4-5-25-20(34)12-7-13(31)14(32)8-26-12/h7-8,10,27,32H,2-6H2,1H3,(H,25,34)(H,26,31)(H,28,35)(H,29,30,33)/t10-/m0/s1

Standard InChI Key:  ZJOVVADZPGXOGF-JTQLQIEISA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    3.2192   -0.7844    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4223   -0.9980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8389   -0.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0421   -0.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8285   -1.4250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4587   -0.0448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3381   -0.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6337   -0.9852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4575   -0.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0409   -1.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8377   -1.3550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0512   -0.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4679    0.0251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6710   -0.1884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9792    0.2608    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8481   -0.3447    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0616    0.4521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4783    1.0355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8585    0.6657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5258    0.1809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5258   -0.6441    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -6.1931    0.6657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9900    0.4521    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -5.9383    1.4502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3507    2.1647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1134    1.4502    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8025   -1.3678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5994   -1.1543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8130   -0.3574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6098   -0.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1931   -0.7273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9796   -1.5241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1828   -1.7376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5630   -2.1075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9900   -0.5138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5890   -2.1647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  4  5  2  0
  6  4  1  0
  7  6  1  0
  7  8  2  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
  9 14  2  0
 14 15  1  0
 15  7  1  0
 12 16  1  6
 17 16  1  0
 17 18  2  0
 19 17  1  0
 19 20  2  0
 20 21  1  0
 20 22  1  0
 22 23  1  0
 22 24  2  0
 24 25  1  0
 24 26  1  0
 26 19  1  0
  1 27  1  0
 27 28  1  0
 29 28  1  0
 30 29  1  0
 31 30  2  0
 32 31  1  0
 33 32  1  0
 28 33  2  0
 32 34  2  0
 31 35  1  0
 27 36  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5284613

    ---

Associated Targets(non-human)

gyrB DNA gyrase (2092 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 553.43Molecular Weight (Monoisotopic): 552.0749AlogP: 2.53#Rotatable Bonds: 7
Polar Surface Area: 169.07Molecular Species: NEUTRALHBA: 7HBD: 6
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 3
CX Acidic pKa: 7.93CX Basic pKa: CX LogP: 1.61CX LogD: 1.50
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.26Np Likeness Score: -1.35

References

1. He M, Fan M, Peng Z, Wang G..  (2021)  An overview of hydroxypyranone and hydroxypyridinone as privileged scaffolds for novel drug discovery.,  221  [PMID:34023737] [10.1016/j.ejmech.2021.113546]

Source