(S)-2-(4-((5-((1-(3-cyclopropylphenyl)ethyl)carbamoyl)-2,3-dimethyl-1H-indol-1-yl)methyl)phenyl)-2-methylpropanoic acid

ID: ALA5284640

Max Phase: Preclinical

Molecular Formula: C33H36N2O3

Molecular Weight: 508.66

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1c(C)n(Cc2ccc(C(C)(C)C(=O)O)cc2)c2ccc(C(=O)N[C@@H](C)c3cccc(C4CC4)c3)cc12

Standard InChI:  InChI=1S/C33H36N2O3/c1-20-22(3)35(19-23-9-14-28(15-10-23)33(4,5)32(37)38)30-16-13-27(18-29(20)30)31(36)34-21(2)25-7-6-8-26(17-25)24-11-12-24/h6-10,13-18,21,24H,11-12,19H2,1-5H3,(H,34,36)(H,37,38)/t21-/m0/s1

Standard InChI Key:  DVWSHWWLAFDNHD-NRFANRHFSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    5.8145   -1.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1005   -1.4534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0995   -2.2784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9215    1.0266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9227    0.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2064   -0.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4884    0.1980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4913    1.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2082    1.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6334    1.4414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0468    2.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4601    1.4412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7769    1.4463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0594    1.0356    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7800    2.2730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3450    1.4517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6275    1.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3481    2.2784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6275    0.2154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0891   -0.1950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0814    1.4588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7987    1.0520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8087    0.2214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6018   -0.0257    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0819    0.6521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5855    1.3181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8314    2.1075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9086    0.6623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8668   -0.8088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6774   -0.9709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9370   -1.7550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7467   -1.9174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2934   -1.2960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0246   -0.5097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2154   -0.3511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6492   -0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4601   -0.9964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3832   -0.0525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  4 10  1  0
 11 10  1  0
 12 11  1  0
 10 12  1  0
  8 13  1  0
 13 14  1  0
 13 15  1  6
 14 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  2  0
 19 20  1  0
 21 17  1  0
 22 21  2  0
 20 23  2  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 22  1  0
 26 27  1  0
 25 28  1  0
 24 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33  2  1  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
  2 36  1  0
 36 37  1  0
 36 38  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5284640

    ---

Associated Targets(Human)

PPARG Tclin Peroxisome proliferator-activated receptor gamma (15191 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 508.66Molecular Weight (Monoisotopic): 508.2726AlogP: 7.04#Rotatable Bonds: 8
Polar Surface Area: 71.33Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.37CX Basic pKa: CX LogP: 7.47CX LogD: 4.56
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: -0.95

References

1. Xu XT, Shi LY, Ban YJ, Luo BL, Zhu GF, Guo B, Tang L, Sang ZP, Wang JT..  (2023)  Design, synthesis and biological evaluation of cajanonic acid A analogues as potent PPAR γ antagonists.,  80  [PMID:36414176] [10.1016/j.bmcl.2022.129081]

Source