6-Bromo-3-(2-chloro-5-nitrostyryl)-2-methylquinazolin-4(3H)-one

ID: ALA5284642

Max Phase: Preclinical

Molecular Formula: C17H11BrClN3O3

Molecular Weight: 420.65

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nc2ccc(Br)cc2c(=O)n1/C=C/c1cc([N+](=O)[O-])ccc1Cl

Standard InChI:  InChI=1S/C17H11BrClN3O3/c1-10-20-16-5-2-12(18)9-14(16)17(23)21(10)7-6-11-8-13(22(24)25)3-4-15(11)19/h2-9H,1H3/b7-6+

Standard InChI Key:  KAOXBBCJDCDTGQ-VOTSOKGWSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   -4.2846    0.2073    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -3.5701   -0.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5701   -1.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8540   -1.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1440   -1.0296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4264   -1.4437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149   -1.0271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0005   -1.4396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149   -0.2063    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0023    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7121   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4268    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1440   -0.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8557    0.2082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8557    1.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1394    1.4418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4268    1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7123    1.4437    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.5701   -0.2041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2846    0.2082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5701   -1.0292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4315    0.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4315    1.0310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1440   -0.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8557    0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  7  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 12  2  0
 17 18  1  0
 19 14  1  0
 19 20  2  0
 19 21  1  0
  9 22  1  0
 22 23  2  0
 24 22  1  0
  5 24  2  0
 24 25  1  0
 25  2  2  0
M  CHG  2  19   1  21  -1
M  END

Alternative Forms

  1. Parent:

    ALA5284642

    ---

Associated Targets(non-human)

Tobacco mosaic virus (2972 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 420.65Molecular Weight (Monoisotopic): 418.9672AlogP: 4.66#Rotatable Bonds: 3
Polar Surface Area: 78.03Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.60CX LogP: 4.42CX LogD: 4.42
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.46Np Likeness Score: -1.42

References

1. Alagarsamy V, Chitra K, Saravanan G, Solomon VR, Sulthana MT, Narendhar B..  (2018)  An overview of quinazolines: Pharmacological significance and recent developments.,  151  [PMID:29656203] [10.1016/j.ejmech.2018.03.076]

Source