The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3R,3aS,6aR)-hexahydrofuro[2,3-b]furan-3-yl ((2S,3R)-4-((4-((S)-2-amino-3-methylbutanamido)-N-isobutylphenyl)sulfonamido)-3-hydroxy-1-phenylbutan-2-yl)carbamate ID: ALA5284706
Max Phase: Preclinical
Molecular Formula: C32H46N4O8S
Molecular Weight: 646.81
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]1CO[C@H]2OCC[C@H]21)S(=O)(=O)c1ccc(NC(=O)[C@@H](N)C(C)C)cc1
Standard InChI: InChI=1S/C32H46N4O8S/c1-20(2)17-36(45(40,41)24-12-10-23(11-13-24)34-30(38)29(33)21(3)4)18-27(37)26(16-22-8-6-5-7-9-22)35-32(39)44-28-19-43-31-25(28)14-15-42-31/h5-13,20-21,25-29,31,37H,14-19,33H2,1-4H3,(H,34,38)(H,35,39)/t25-,26-,27+,28-,29-,31+/m0/s1
Standard InChI Key: LHKBMVVTDCJRMX-MPJPHXCBSA-N
Molfile:
RDKit 2D
47 50 0 0 0 0 0 0 0 0999 V2000
1.1954 1.4434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4808 1.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2337 1.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9483 1.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6628 1.4434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6628 2.2679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3774 2.6802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.0920 2.2679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8341 2.5977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3838 1.9931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9715 1.2785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1745 1.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7714 0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3194 0.1345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0610 0.4696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3672 1.6148 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.7686 1.0649 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.9483 2.6802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9483 0.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6628 -0.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3774 0.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0920 -0.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0920 -1.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3774 -1.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6628 -1.0575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2337 2.2679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1954 2.2679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9100 2.6802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9100 3.5047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6246 2.2679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9100 1.0311 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.9100 0.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6246 -0.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6246 -1.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9100 -1.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9100 -2.2669 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6246 -2.6795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6246 -3.5047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3393 -2.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0540 -2.6795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1954 -1.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1954 -0.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7367 1.0311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3234 1.7453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3393 -1.4416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7686 -2.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0540 -3.5047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
7 6 1 0
8 7 1 6
9 8 1 0
10 9 1 0
10 11 1 0
11 12 1 0
12 8 1 0
12 13 1 0
13 14 1 0
14 15 1 0
11 15 1 0
12 16 1 1
11 17 1 1
18 6 2 0
4 19 1 6
20 19 1 0
21 20 1 0
22 21 2 0
23 22 1 0
23 24 2 0
24 25 1 0
25 20 2 0
3 26 1 6
1 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
1 31 1 0
32 31 1 0
33 32 1 0
33 34 2 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 2 0
37 39 1 0
39 40 1 0
35 41 2 0
41 42 1 0
42 32 2 0
31 43 2 0
31 44 2 0
39 45 1 1
40 46 1 0
40 47 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 646.81Molecular Weight (Monoisotopic): 646.3036AlogP: 2.71#Rotatable Bonds: 14Polar Surface Area: 169.52Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.56CX Basic pKa: 8.35CX LogP: 3.42CX LogD: 2.42Aromatic Rings: 2Heavy Atoms: 45QED Weighted: 0.24Np Likeness Score: -0.05
References 1. Ghosh AK, Shahabi D, Kipfmiller M, Ghosh AK, Johnson M, Wang YF, Agniswamy J, Amano M, Weber IT, Mitsuya H.. (2023) Evaluation of darunavir-derived HIV-1 protease inhibitors incorporating P2' amide-derivatives: Synthesis, biological evaluation and structural studies., 83 [PMID:36738797 ] [10.1016/j.bmcl.2023.129168 ]