3,5-difluoro-N-(3-(4-(((4-(4-methylpiperazin-1-yl)phenyl)amino)methyl)-1H-1,2,3-triazol-1-yl)phenyl)benzamide

ID: ALA5284741

Max Phase: Preclinical

Molecular Formula: C27H27F2N7O

Molecular Weight: 503.56

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CCN(c2ccc(NCc3cn(-c4cccc(NC(=O)c5cc(F)cc(F)c5)c4)nn3)cc2)CC1

Standard InChI:  InChI=1S/C27H27F2N7O/c1-34-9-11-35(12-10-34)25-7-5-22(6-8-25)30-17-24-18-36(33-32-24)26-4-2-3-23(16-26)31-27(37)19-13-20(28)15-21(29)14-19/h2-8,13-16,18,30H,9-12,17H2,1H3,(H,31,37)

Standard InChI Key:  NKAAFQHJGCVXBL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   -6.1600   -0.4607    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4455   -0.0481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7294   -0.4561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0195   -0.0444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0195    0.7804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7311    1.1922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7311    2.0171    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4455    0.7800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3050   -0.4570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5906   -0.0444    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8762   -0.4570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1616   -0.0446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4497   -0.4565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2646   -0.0441    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2646    0.7807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0686    1.0309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2821    1.8277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0789    2.0412    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6622    1.4579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5392    0.3774    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0473   -0.2899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4497   -1.2817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1598   -1.6936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8762   -1.2854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3050   -1.2819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4592    1.6712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0402    1.0891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8267    0.2920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0342    0.0780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4478    0.6576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4100   -0.2913    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2068   -0.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7901   -0.6611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5766   -1.4579    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7798   -1.6714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1965   -1.0881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1600   -2.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  8  2  1  0
  4  9  1  0
  9 10  1  0
 10 11  1  0
 12 11  2  0
 13 12  1  0
 14 13  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 16 20  1  0
 21 20  2  0
 14 21  1  0
 22 13  2  0
 23 22  1  0
 24 23  2  0
 11 24  1  0
  9 25  2  0
 26 19  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 19 30  1  0
 31 28  1  0
 31 32  1  0
 33 32  1  0
 34 33  1  0
 35 34  1  0
 31 36  1  0
 36 35  1  0
 34 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5284741

    ---

Associated Targets(Human)

ALK Tclin ALK tyrosine kinase receptor (7132 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 503.56Molecular Weight (Monoisotopic): 503.2245AlogP: 4.16#Rotatable Bonds: 7
Polar Surface Area: 78.32Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.93CX Basic pKa: 8.02CX LogP: 4.29CX LogD: 3.57
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.39Np Likeness Score: -2.14

References

1. Cui Y, Tan Z, Liu S, Cao Z, Shao B, Guo M, Jiang N, Zhai X..  (2022)  Fragment-based discovery of novel phenyltriazolyl derivatives as allosteric type-I1/2 ALK inhibitors with promising antitumor effects.,  75  [PMID:36113668] [10.1016/j.bmcl.2022.128990]

Source