The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,5-difluoro-N-(3-(4-(((4-(4-methylpiperazin-1-yl)phenyl)amino)methyl)-1H-1,2,3-triazol-1-yl)phenyl)benzamide ID: ALA5284741
Max Phase: Preclinical
Molecular Formula: C27H27F2N7O
Molecular Weight: 503.56
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(c2ccc(NCc3cn(-c4cccc(NC(=O)c5cc(F)cc(F)c5)c4)nn3)cc2)CC1
Standard InChI: InChI=1S/C27H27F2N7O/c1-34-9-11-35(12-10-34)25-7-5-22(6-8-25)30-17-24-18-36(33-32-24)26-4-2-3-23(16-26)31-27(37)19-13-20(28)15-21(29)14-19/h2-8,13-16,18,30H,9-12,17H2,1H3,(H,31,37)
Standard InChI Key: NKAAFQHJGCVXBL-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
-6.1600 -0.4607 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.4455 -0.0481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7294 -0.4561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0195 -0.0444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0195 0.7804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7311 1.1922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7311 2.0171 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-5.4455 0.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3050 -0.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5906 -0.0444 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8762 -0.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1616 -0.0446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4497 -0.4565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2646 -0.0441 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2646 0.7807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0686 1.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2821 1.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0789 2.0412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6622 1.4579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5392 0.3774 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0473 -0.2899 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4497 -1.2817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1598 -1.6936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8762 -1.2854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3050 -1.2819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4592 1.6712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0402 1.0891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8267 0.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0342 0.0780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4478 0.6576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4100 -0.2913 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2068 -0.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7901 -0.6611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5766 -1.4579 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7798 -1.6714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1965 -1.0881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1600 -2.0412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
6 8 2 0
8 2 1 0
4 9 1 0
9 10 1 0
10 11 1 0
12 11 2 0
13 12 1 0
14 13 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 1 0
16 20 1 0
21 20 2 0
14 21 1 0
22 13 2 0
23 22 1 0
24 23 2 0
11 24 1 0
9 25 2 0
26 19 2 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 2 0
19 30 1 0
31 28 1 0
31 32 1 0
33 32 1 0
34 33 1 0
35 34 1 0
31 36 1 0
36 35 1 0
34 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.56Molecular Weight (Monoisotopic): 503.2245AlogP: 4.16#Rotatable Bonds: 7Polar Surface Area: 78.32Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.93CX Basic pKa: 8.02CX LogP: 4.29CX LogD: 3.57Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.39Np Likeness Score: -2.14
References 1. Cui Y, Tan Z, Liu S, Cao Z, Shao B, Guo M, Jiang N, Zhai X.. (2022) Fragment-based discovery of novel phenyltriazolyl derivatives as allosteric type-I1/2 ALK inhibitors with promising antitumor effects., 75 [PMID:36113668 ] [10.1016/j.bmcl.2022.128990 ]