The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(1-(5-Ethylpyrimidin-2-yl)piperidin-4-yl)propyl 5-(methylsulfonyl)indoline-1-carboxylate ID: ALA5284750
Max Phase: Preclinical
Molecular Formula: C24H32N4O4S
Molecular Weight: 472.61
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1cnc(N2CCC(C(C)COC(=O)N3CCc4cc(S(C)(=O)=O)ccc43)CC2)nc1
Standard InChI: InChI=1S/C24H32N4O4S/c1-4-18-14-25-23(26-15-18)27-10-7-19(8-11-27)17(2)16-32-24(29)28-12-9-20-13-21(33(3,30)31)5-6-22(20)28/h5-6,13-15,17,19H,4,7-12,16H2,1-3H3
Standard InChI Key: XZSYLJROTVZWRR-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-3.6907 -1.1555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8701 -1.2402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5358 -0.4858 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1500 0.0650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8638 -0.3489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5839 0.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5839 0.8940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2982 1.3064 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-6.0124 0.8940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7098 2.0220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8850 2.0220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8656 1.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1500 0.8944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7392 -0.2724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1559 -0.8556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3592 -0.6421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5257 0.5242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2239 -1.2253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0206 -1.0119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0104 -2.0220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2340 -0.2152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0307 -0.0018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6139 -0.5850 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4005 -1.3817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6038 -1.5951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4107 -0.3715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6244 0.4251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4189 0.6372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0023 0.0538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7914 -0.7393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9964 -0.9572 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7989 0.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0124 1.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
5 4 1 0
5 1 1 0
6 5 2 0
7 6 1 0
7 8 1 0
8 9 1 0
8 10 2 0
8 11 2 0
12 7 2 0
13 12 1 0
4 13 2 0
3 14 1 0
14 15 1 0
15 16 1 0
14 17 2 0
16 18 1 0
18 19 1 0
18 20 1 0
21 19 1 0
22 21 1 0
23 22 1 0
24 23 1 0
25 24 1 0
19 25 1 0
26 23 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
26 31 1 0
31 30 2 0
29 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.61Molecular Weight (Monoisotopic): 472.2144AlogP: 3.49#Rotatable Bonds: 6Polar Surface Area: 92.70Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.00CX LogP: 3.40CX LogD: 3.40Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.64Np Likeness Score: -1.27
References 1. Zhu Y, Zhao J, Luo L, Gao Y, Bao H, Li P, Zhang H.. (2021) Research progress of indole compounds with potential antidiabetic activity., 223 [PMID:34192642 ] [10.1016/j.ejmech.2021.113665 ]