2-(4-hydroxy-3-methoxybenzylidene)-7,7-dimethyl-8,9-dihydro-2H-furo[2,3-f]chromen-3(7H)-one

ID: ALA5284763

Max Phase: Preclinical

Molecular Formula: C21H20O5

Molecular Weight: 352.39

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(/C=C2\Oc3c(ccc4c3CCC(C)(C)O4)C2=O)ccc1O

Standard InChI:  InChI=1S/C21H20O5/c1-21(2)9-8-13-16(26-21)7-5-14-19(23)18(25-20(13)14)11-12-4-6-15(22)17(10-12)24-3/h4-7,10-11,22H,8-9H2,1-3H3/b18-11-

Standard InChI Key:  LMFRKIUAGPCEBF-WQRHYEAKSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   -3.5607   -1.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1483   -0.9534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9748   -0.9534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1483   -0.1279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4336    0.2850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4336    1.1061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7237    1.5229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0058    1.1087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2209    1.3637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0074    2.1606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2640    0.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0891    0.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5016   -0.0184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0873   -0.7361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5037   -1.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3246   -1.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7373   -0.7314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3266   -0.0184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5623   -0.7314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9748   -0.0169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7372   -2.1606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2210    0.0284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0058    0.2834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7186   -0.1274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7186   -0.9530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4332   -1.3659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  4  2  1  0
  5  4  1  0
  6  5  1  0
  7  6  2  0
  8  7  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 13  2  0
 17 19  1  0
 19 20  1  0
 16 21  1  0
 11 22  1  0
 23 22  1  0
  8 23  2  0
  5 24  2  0
 23 24  1  0
 24 25  1  0
  2 26  1  0
 26 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5284763

    ---

Associated Targets(non-human)

Nos2 Nitric oxide synthase, inducible (3573 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 352.39Molecular Weight (Monoisotopic): 352.1311AlogP: 4.12#Rotatable Bonds: 2
Polar Surface Area: 64.99Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.29CX Basic pKa: CX LogP: 3.76CX LogD: 3.76
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.82Np Likeness Score: 0.83

References

1. Sui G, Li T, Zhang B, Wang R, Hao H, Zhou W..  (2021)  Recent advances on synthesis and biological activities of aurones.,  29  [PMID:33271454] [10.1016/j.bmc.2020.115895]

Source