Methyl (3-(3,5-dimethoxyphenyl)-2-(4-(4-((2,4-dioxothiazolidin-5-yl)methyl)phenoxy)phenyl)acrylate

ID: ALA5284791

Max Phase: Preclinical

Molecular Formula: C28H25NO7S

Molecular Weight: 519.58

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)/C(=C\c1cc(OC)cc(OC)c1)c1ccc(Oc2ccc(CC3SC(=O)NC3=O)cc2)cc1

Standard InChI:  InChI=1S/C28H25NO7S/c1-33-22-12-18(13-23(16-22)34-2)14-24(27(31)35-3)19-6-10-21(11-7-19)36-20-8-4-17(5-9-20)15-25-26(30)29-28(32)37-25/h4-14,16,25H,15H2,1-3H3,(H,29,30,32)/b24-14-

Standard InChI Key:  IVAQJHSXBVHUQT-OYKKKHCWSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   -4.9772    0.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2626    0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5508    0.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5508   -0.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2609   -0.8238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9772   -0.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6919    0.8253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4066    0.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2609   -1.6490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5462   -2.0616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8361    0.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1215    0.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4069    0.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1215   -0.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4069   -0.8246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8361   -0.8246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4069   -1.6498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4066    1.6509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6938    2.0616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0210    1.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0225    0.8278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6891    0.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7356    2.0615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4503    1.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1651    2.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8771    1.6492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8771    0.8238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1669    0.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4503    0.8201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5918    0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3064    0.8238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3064    1.6490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1106    1.8992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5814    1.2455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0893    0.5780    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.5918    2.0616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4066    1.2455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  1  7  1  0
  7  8  1  0
  5  9  1  0
  9 10  1  0
  3 11  1  0
 11 12  2  0
 12 13  1  0
 12 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 18 13  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 13 22  1  0
 20 23  1  0
 23 24  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 24 29  1  0
 27 30  1  0
 30 31  1  0
 32 31  1  0
 32 33  1  0
 33 34  1  0
 35 34  1  0
 31 35  1  0
 32 36  2  0
 34 37  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5284791

    ---

Associated Targets(Human)

PPARG Tclin Peroxisome proliferator-activated receptor gamma (15191 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 519.58Molecular Weight (Monoisotopic): 519.1352AlogP: 5.10#Rotatable Bonds: 9
Polar Surface Area: 100.16Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.61CX Basic pKa: CX LogP: 5.34CX LogD: 4.52
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.24Np Likeness Score: -0.02

References

1. Naim MJ, Alam MJ, Ahmad S, Nawaz F, Shrivastava N, Sahu M, Alam O..  (2017)  Therapeutic journey of 2,4-thiazolidinediones as a versatile scaffold: An insight into structure activity relationship.,  129  [PMID:28231521] [10.1016/j.ejmech.2017.02.031]

Source