The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl (3-(3,5-dimethoxyphenyl)-2-(4-(4-((2,4-dioxothiazolidin-5-yl)methyl)phenoxy)phenyl)acrylate ID: ALA5284791
Max Phase: Preclinical
Molecular Formula: C28H25NO7S
Molecular Weight: 519.58
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)/C(=C\c1cc(OC)cc(OC)c1)c1ccc(Oc2ccc(CC3SC(=O)NC3=O)cc2)cc1
Standard InChI: InChI=1S/C28H25NO7S/c1-33-22-12-18(13-23(16-22)34-2)14-24(27(31)35-3)19-6-10-21(11-7-19)36-20-8-4-17(5-9-20)15-25-26(30)29-28(32)37-25/h4-14,16,25H,15H2,1-3H3,(H,29,30,32)/b24-14-
Standard InChI Key: IVAQJHSXBVHUQT-OYKKKHCWSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
-4.9772 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2626 0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5508 0.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5508 -0.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2609 -0.8238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9772 -0.4157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6919 0.8253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4066 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2609 -1.6490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5462 -2.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8361 0.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1215 0.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4069 0.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1215 -0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4069 -0.8246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8361 -0.8246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4069 -1.6498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4066 1.6509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6938 2.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0210 1.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0225 0.8278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6891 0.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7356 2.0615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4503 1.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1651 2.0613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8771 1.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8771 0.8238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1669 0.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4503 0.8201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5918 0.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3064 0.8238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3064 1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1106 1.8992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5814 1.2455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0893 0.5780 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.5918 2.0616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4066 1.2455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
1 7 1 0
7 8 1 0
5 9 1 0
9 10 1 0
3 11 1 0
11 12 2 0
12 13 1 0
12 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
18 13 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
13 22 1 0
20 23 1 0
23 24 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
27 30 1 0
30 31 1 0
32 31 1 0
32 33 1 0
33 34 1 0
35 34 1 0
31 35 1 0
32 36 2 0
34 37 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.58Molecular Weight (Monoisotopic): 519.1352AlogP: 5.10#Rotatable Bonds: 9Polar Surface Area: 100.16Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.61CX Basic pKa: ┄CX LogP: 5.34CX LogD: 4.52Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.24Np Likeness Score: -0.02
References 1. Naim MJ, Alam MJ, Ahmad S, Nawaz F, Shrivastava N, Sahu M, Alam O.. (2017) Therapeutic journey of 2,4-thiazolidinediones as a versatile scaffold: An insight into structure activity relationship., 129 [PMID:28231521 ] [10.1016/j.ejmech.2017.02.031 ]