The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-(4'-(3-(3-(3-fluoro-5-(trifluoromethyl)pyridin-2-yl)ureido)-2-oxopiperidin-1-yl)-3'-methoxy-[1,1'-biphenyl]-2-yl)methanesulfonamide ID: ALA5284802
Max Phase: Preclinical
Molecular Formula: C26H25F4N5O5S
Molecular Weight: 595.58
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(-c2ccccc2NS(C)(=O)=O)ccc1N1CCC[C@@H](NC(=O)Nc2ncc(C(F)(F)F)cc2F)C1=O
Standard InChI: InChI=1S/C26H25F4N5O5S/c1-40-22-12-15(17-6-3-4-7-19(17)34-41(2,38)39)9-10-21(22)35-11-5-8-20(24(35)36)32-25(37)33-23-18(27)13-16(14-31-23)26(28,29)30/h3-4,6-7,9-10,12-14,20,34H,5,8,11H2,1-2H3,(H2,31,32,33,37)/t20-/m1/s1
Standard InChI Key: BURKKFWHPLNTHR-HXUWFJFHSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
-4.6253 -0.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6253 -1.2325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9119 -1.6389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2047 -1.2289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2047 -0.4071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9137 0.0030 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4931 0.0037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7814 -0.4071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0697 0.0037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3581 -0.4071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3535 0.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3535 0.8255 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0652 -0.4071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7769 0.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7771 0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4870 1.2345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1989 0.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2005 0.0058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4916 -0.4088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0652 -1.2289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3535 -1.6398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3581 -1.2289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7814 -1.2289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3370 -1.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9105 1.2344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9108 2.0562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6207 2.4652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3326 2.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3342 1.2365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6253 0.8217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6253 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3370 -0.4109 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.0486 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9254 -1.1238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7471 -1.1238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3370 -2.4652 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.0486 -1.2325 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.0486 -2.0543 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.4931 -1.6398 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.0654 1.2364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0654 2.0581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
5 7 1 0
7 8 1 0
8 9 1 0
10 9 1 1
10 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 2 0
14 19 1 0
13 20 1 0
21 20 1 0
22 21 1 0
10 22 1 0
8 23 2 0
2 24 1 0
25 17 1 0
26 25 2 0
27 26 1 0
28 27 2 0
29 28 1 0
25 30 1 0
30 29 2 0
30 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
32 35 2 0
24 36 1 0
24 37 1 0
24 38 1 0
4 39 1 0
15 40 1 0
40 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 595.58Molecular Weight (Monoisotopic): 595.1513AlogP: 4.60#Rotatable Bonds: 7Polar Surface Area: 129.73Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.10CX Basic pKa: 1.61CX LogP: 2.76CX LogD: 2.75Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.34Np Likeness Score: -1.52
References 1. Maciuszek M, Cacace A, Brennan E, Godson C, Chapman TM.. (2021) Recent advances in the design and development of formyl peptide receptor 2 (FPR2/ALX) agonists as pro-resolving agents with diverse therapeutic potential., 213 [PMID:33486199 ] [10.1016/j.ejmech.2021.113167 ]