(4-(((3-methoxy-N-(4-(thiophen-2-yl)thiazol-2-yl)phenyl)sulfonamido)methyl)phenyl)sulfamic acid

ID: ALA5284833

Max Phase: Preclinical

Molecular Formula: C21H19N3O6S4

Molecular Weight: 537.67

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(S(=O)(=O)N(Cc2ccc(NS(=O)(=O)O)cc2)c2nc(-c3cccs3)cs2)c1

Standard InChI:  InChI=1S/C21H19N3O6S4/c1-30-17-4-2-5-18(12-17)33(25,26)24(21-22-19(14-32-21)20-6-3-11-31-20)13-15-7-9-16(10-8-15)23-34(27,28)29/h2-12,14,23H,13H2,1H3,(H,27,28,29)

Standard InChI Key:  YCQAYYKPDURFRM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    1.4905    1.8830    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.7724    1.4770    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0616    1.8958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6565    1.4897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6638    0.6647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3821    0.2586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0928    0.6775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8110    0.2714    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5217    0.6902    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5144    1.5153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0854    1.5025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3672    1.9086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7650    0.6520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3470    0.6902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7353   -0.1068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2053    1.4704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4759    0.2330    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.2832   -0.5868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4810   -0.6605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1556    0.1023    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0683   -1.3753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9201    1.8829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6323    1.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6323    0.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9219    0.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2053    0.6416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4810   -2.0899    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0903   -2.7088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8250   -2.3780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7326   -1.5538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0779    2.5978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9032    2.5978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3470    1.8835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3470    2.7088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  7  6  1  0
  7  8  1  0
  9  8  1  0
  9 10  1  0
  7 11  2  0
 11 12  1  0
 12  4  2  0
 13  2  1  0
  9 14  2  0
  9 15  2  0
  1 16  1  0
 17 13  1  0
 17 18  1  0
 18 19  2  0
 20 19  1  0
 13 20  2  0
 19 21  1  0
 22 16  2  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 16 26  1  0
 27 21  1  0
 27 28  1  0
 28 29  2  0
 30 29  1  0
 21 30  2  0
  1 31  2  0
  1 32  2  0
 23 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5284833

    ---

Associated Targets(Human)

PTPRB Tchem Receptor-type tyrosine-protein phosphatase beta (330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 537.67Molecular Weight (Monoisotopic): 537.0157AlogP: 4.49#Rotatable Bonds: 9
Polar Surface Area: 125.90Molecular Species: ACIDHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: -1.83CX Basic pKa: CX LogP: 2.16CX LogD: 1.52
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: -1.88

References

1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S..  (2020)  Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors.,  28  (23.0): [PMID:32992253] [10.1016/j.bmc.2020.115777]

Source